ferris
commited on
Commit
·
82971ba
1
Parent(s):
85423af
v0.1.0
Browse files- 1_Pooling/config.json +10 -0
- README.md +650 -3
- config.json +31 -0
- config_sentence_transformers.json +10 -0
- model.safetensors +3 -0
- modules.json +14 -0
- sentence_bert_config.json +4 -0
- special_tokens_map.json +44 -0
- tokenizer.json +0 -0
- tokenizer_config.json +71 -0
- vocab.txt +0 -0
1_Pooling/config.json
ADDED
@@ -0,0 +1,10 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
{
|
2 |
+
"word_embedding_dimension": 384,
|
3 |
+
"pooling_mode_cls_token": false,
|
4 |
+
"pooling_mode_mean_tokens": true,
|
5 |
+
"pooling_mode_max_tokens": false,
|
6 |
+
"pooling_mode_mean_sqrt_len_tokens": false,
|
7 |
+
"pooling_mode_weightedmean_tokens": false,
|
8 |
+
"pooling_mode_lasttoken": false,
|
9 |
+
"include_prompt": true
|
10 |
+
}
|
README.md
CHANGED
@@ -1,3 +1,650 @@
|
|
1 |
-
---
|
2 |
-
|
3 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
---
|
2 |
+
base_model: TaylorAI/bge-micro
|
3 |
+
datasets: []
|
4 |
+
language:
|
5 |
+
- en
|
6 |
+
library_name: sentence-transformers
|
7 |
+
license: apache-2.0
|
8 |
+
metrics:
|
9 |
+
- pearson_cosine
|
10 |
+
- spearman_cosine
|
11 |
+
- pearson_manhattan
|
12 |
+
- spearman_manhattan
|
13 |
+
- pearson_euclidean
|
14 |
+
- spearman_euclidean
|
15 |
+
- pearson_dot
|
16 |
+
- spearman_dot
|
17 |
+
- pearson_max
|
18 |
+
- spearman_max
|
19 |
+
pipeline_tag: sentence-similarity
|
20 |
+
tags:
|
21 |
+
- sentence-transformers
|
22 |
+
- sentence-similarity
|
23 |
+
- feature-extraction
|
24 |
+
- generated_from_trainer
|
25 |
+
- dataset_size:3210255
|
26 |
+
- loss:CachedMultipleNegativesRankingLoss
|
27 |
+
widget:
|
28 |
+
- source_sentence: donepezil hydrochloride monohydrate
|
29 |
+
sentences:
|
30 |
+
- Cn1nccc1[C@H]1CC[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1OC(=O)c1ccccc1
|
31 |
+
- COc1cc2c(cc1OC)C(=O)C(CC1CCN(Cc3ccccc3)CC1)C2.Cl.O
|
32 |
+
- C(=O)(OC)C1=CC=C(C=C1)CC(C)=O
|
33 |
+
- source_sentence: 6-Cyclopropylmethoxy-5-(3,3-difluoro-azetidin-1-yl)-pyridine-2-carboxylic
|
34 |
+
acid tert-butyl-(5-methyl-[1,3,4]oxadiazol-2-ylmethyl)-amide
|
35 |
+
sentences:
|
36 |
+
- Cc1nnc(CN(C(=O)c2ccc(N3CC(F)(F)C3)c(OCC3CC3)n2)C(C)(C)C)o1
|
37 |
+
- COc1cccc(CCCC=C(Br)Br)c1
|
38 |
+
- CN(C)CCNC(=O)c1ccc2oc(=O)n(Cc3ccc4[nH]c(=O)[nH]c4c3)c2c1
|
39 |
+
- source_sentence: N-(2-chlorophenyl)-6,8-difluoro-N-methyl-4H-thieno[3,2-c]chromene-2-carboxamide
|
40 |
+
sentences:
|
41 |
+
- CN(C(=O)c1cc2c(s1)-c1cc(F)cc(F)c1OC2)c1ccccc1Cl
|
42 |
+
- ClC(C(=O)OCCOCC1=CC=C(C=C1)F)C
|
43 |
+
- C(C)OC(\C=C(/C)\OC1=C(C(=CC=C1F)OC(C)C)F)=O
|
44 |
+
- source_sentence: 6-[2-[(3-chlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine
|
45 |
+
sentences:
|
46 |
+
- CC(=O)OCCOCn1cc(C)c(=O)[nH]c1=O
|
47 |
+
- NC1=C(C(=NN1C1=C(C=C(C=C1Cl)C(F)(F)F)Cl)C#N)S(=O)(=O)C
|
48 |
+
- ClC=1C=C(C=CC1)CN1CC2CN(CC2C1)C=1C=CC=2N(N1)C(=NN2)C(F)(F)F
|
49 |
+
- source_sentence: (±)-cis-2-(4-methoxyphenyl)-3-acetoxy-5-[2-(dimethylamino)ethyl]-8-chloro-2,3-dihydro-1,5-benzothiazepin-4(5H)-one
|
50 |
+
hydrochloride
|
51 |
+
sentences:
|
52 |
+
- N(=[N+]=[N-])C(C(=O)C1=NC(=C(C(=N1)C(C)(C)C)O)C(C)(C)C)C
|
53 |
+
- O[C@@H]1[C@H](O)[C@@H](Oc2nc(N3CCNCC3)nc3ccccc23)C[C@H]1O
|
54 |
+
- Cl.COC1=CC=C(C=C1)[C@@H]1SC2=C(N(C([C@@H]1OC(C)=O)=O)CCN(C)C)C=CC(=C2)Cl
|
55 |
+
model-index:
|
56 |
+
- name: MPNet base trained on AllNLI triplets
|
57 |
+
results:
|
58 |
+
- task:
|
59 |
+
type: semantic-similarity
|
60 |
+
name: Semantic Similarity
|
61 |
+
dataset:
|
62 |
+
name: bge micro test
|
63 |
+
type: bge-micro-test
|
64 |
+
metrics:
|
65 |
+
- type: pearson_cosine
|
66 |
+
value: .nan
|
67 |
+
name: Pearson Cosine
|
68 |
+
- type: spearman_cosine
|
69 |
+
value: .nan
|
70 |
+
name: Spearman Cosine
|
71 |
+
- type: pearson_manhattan
|
72 |
+
value: .nan
|
73 |
+
name: Pearson Manhattan
|
74 |
+
- type: spearman_manhattan
|
75 |
+
value: .nan
|
76 |
+
name: Spearman Manhattan
|
77 |
+
- type: pearson_euclidean
|
78 |
+
value: .nan
|
79 |
+
name: Pearson Euclidean
|
80 |
+
- type: spearman_euclidean
|
81 |
+
value: .nan
|
82 |
+
name: Spearman Euclidean
|
83 |
+
- type: pearson_dot
|
84 |
+
value: .nan
|
85 |
+
name: Pearson Dot
|
86 |
+
- type: spearman_dot
|
87 |
+
value: .nan
|
88 |
+
name: Spearman Dot
|
89 |
+
- type: pearson_max
|
90 |
+
value: .nan
|
91 |
+
name: Pearson Max
|
92 |
+
- type: spearman_max
|
93 |
+
value: .nan
|
94 |
+
name: Spearman Max
|
95 |
+
---
|
96 |
+
|
97 |
+
# MPNet base trained on AllNLI triplets
|
98 |
+
|
99 |
+
This is a [sentence-transformers](https://www.SBERT.net) model finetuned from [TaylorAI/bge-micro](https://huggingface.co/TaylorAI/bge-micro). It maps sentences & paragraphs to a 384-dimensional dense vector space and can be used for semantic textual similarity, semantic search, paraphrase mining, text classification, clustering, and more.
|
100 |
+
|
101 |
+
## Model Details
|
102 |
+
|
103 |
+
### Model Description
|
104 |
+
- **Model Type:** Sentence Transformer
|
105 |
+
- **Base model:** [TaylorAI/bge-micro](https://huggingface.co/TaylorAI/bge-micro) <!-- at revision 4bccbd43513eb9fecf444af6eecde76e55f4c839 -->
|
106 |
+
- **Maximum Sequence Length:** 512 tokens
|
107 |
+
- **Output Dimensionality:** 384 tokens
|
108 |
+
- **Similarity Function:** Cosine Similarity
|
109 |
+
<!-- - **Training Dataset:** Unknown -->
|
110 |
+
- **Language:** en
|
111 |
+
- **License:** apache-2.0
|
112 |
+
|
113 |
+
### Model Sources
|
114 |
+
|
115 |
+
- **Documentation:** [Sentence Transformers Documentation](https://sbert.net)
|
116 |
+
- **Repository:** [Sentence Transformers on GitHub](https://github.com/UKPLab/sentence-transformers)
|
117 |
+
- **Hugging Face:** [Sentence Transformers on Hugging Face](https://huggingface.co/models?library=sentence-transformers)
|
118 |
+
|
119 |
+
### Full Model Architecture
|
120 |
+
|
121 |
+
```
|
122 |
+
SentenceTransformer(
|
123 |
+
(0): Transformer({'max_seq_length': 512, 'do_lower_case': False}) with Transformer model: BertModel
|
124 |
+
(1): Pooling({'word_embedding_dimension': 384, 'pooling_mode_cls_token': False, 'pooling_mode_mean_tokens': True, 'pooling_mode_max_tokens': False, 'pooling_mode_mean_sqrt_len_tokens': False, 'pooling_mode_weightedmean_tokens': False, 'pooling_mode_lasttoken': False, 'include_prompt': True})
|
125 |
+
)
|
126 |
+
```
|
127 |
+
|
128 |
+
## Usage
|
129 |
+
|
130 |
+
### Direct Usage (Sentence Transformers)
|
131 |
+
|
132 |
+
First install the Sentence Transformers library:
|
133 |
+
|
134 |
+
```bash
|
135 |
+
pip install -U sentence-transformers
|
136 |
+
```
|
137 |
+
|
138 |
+
Then you can load this model and run inference.
|
139 |
+
```python
|
140 |
+
from sentence_transformers import SentenceTransformer
|
141 |
+
|
142 |
+
# Download from the 🤗 Hub
|
143 |
+
model = SentenceTransformer("fpc/bge-micro-smiles")
|
144 |
+
# Run inference
|
145 |
+
sentences = [
|
146 |
+
'(±)-cis-2-(4-methoxyphenyl)-3-acetoxy-5-[2-(dimethylamino)ethyl]-8-chloro-2,3-dihydro-1,5-benzothiazepin-4(5H)-one hydrochloride',
|
147 |
+
'Cl.COC1=CC=C(C=C1)[C@@H]1SC2=C(N(C([C@@H]1OC(C)=O)=O)CCN(C)C)C=CC(=C2)Cl',
|
148 |
+
'O[C@@H]1[C@H](O)[C@@H](Oc2nc(N3CCNCC3)nc3ccccc23)C[C@H]1O',
|
149 |
+
]
|
150 |
+
embeddings = model.encode(sentences)
|
151 |
+
print(embeddings.shape)
|
152 |
+
# [3, 384]
|
153 |
+
|
154 |
+
# Get the similarity scores for the embeddings
|
155 |
+
similarities = model.similarity(embeddings, embeddings)
|
156 |
+
print(similarities.shape)
|
157 |
+
# [3, 3]
|
158 |
+
```
|
159 |
+
|
160 |
+
<!--
|
161 |
+
### Direct Usage (Transformers)
|
162 |
+
|
163 |
+
<details><summary>Click to see the direct usage in Transformers</summary>
|
164 |
+
|
165 |
+
</details>
|
166 |
+
-->
|
167 |
+
|
168 |
+
<!--
|
169 |
+
### Downstream Usage (Sentence Transformers)
|
170 |
+
|
171 |
+
You can finetune this model on your own dataset.
|
172 |
+
|
173 |
+
<details><summary>Click to expand</summary>
|
174 |
+
|
175 |
+
</details>
|
176 |
+
-->
|
177 |
+
|
178 |
+
<!--
|
179 |
+
### Out-of-Scope Use
|
180 |
+
|
181 |
+
*List how the model may foreseeably be misused and address what users ought not to do with the model.*
|
182 |
+
-->
|
183 |
+
|
184 |
+
|
185 |
+
## Training Details
|
186 |
+
|
187 |
+
### Training Dataset
|
188 |
+
|
189 |
+
#### Unnamed Dataset
|
190 |
+
|
191 |
+
|
192 |
+
* Size: 3,210,255 training samples
|
193 |
+
* Columns: <code>anchor</code> and <code>positive</code>
|
194 |
+
* Approximate statistics based on the first 1000 samples:
|
195 |
+
| | anchor | positive |
|
196 |
+
|:--------|:-----------------------------------------------------------------------------------|:-----------------------------------------------------------------------------------|
|
197 |
+
| type | string | string |
|
198 |
+
| details | <ul><li>min: 5 tokens</li><li>mean: 42.57 tokens</li><li>max: 153 tokens</li></ul> | <ul><li>min: 4 tokens</li><li>mean: 40.02 tokens</li><li>max: 325 tokens</li></ul> |
|
199 |
+
* Samples:
|
200 |
+
| anchor | positive |
|
201 |
+
|:--------------------------------------------------------------------------------------------------------------------------|:-----------------------------------------------------------------------------|
|
202 |
+
| <code>4-t-butylbromobenzene</code> | <code>C(C)(C)(C)C1=CC=C(C=C1)Br</code> |
|
203 |
+
| <code>1-methyl-4-(morpholine-4-carbonyl)-N-(2-phenyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-1H-pyrazole-5-carboxamide</code> | <code>CN1N=CC(=C1C(=O)NC1=CC=2N(C=C1)N=C(N2)C2=CC=CC=C2)C(=O)N2CCOCC2</code> |
|
204 |
+
| <code>Phthalimide</code> | <code>C1(C=2C(C(N1)=O)=CC=CC2)=O</code> |
|
205 |
+
* Loss: [<code>CachedMultipleNegativesRankingLoss</code>](https://sbert.net/docs/package_reference/sentence_transformer/losses.html#cachedmultiplenegativesrankingloss) with these parameters:
|
206 |
+
```json
|
207 |
+
{
|
208 |
+
"scale": 20.0,
|
209 |
+
"similarity_fct": "cos_sim"
|
210 |
+
}
|
211 |
+
```
|
212 |
+
|
213 |
+
### Training Hyperparameters
|
214 |
+
#### Non-Default Hyperparameters
|
215 |
+
|
216 |
+
- `per_device_train_batch_size`: 512
|
217 |
+
- `learning_rate`: 2e-05
|
218 |
+
- `num_train_epochs`: 4
|
219 |
+
- `warmup_ratio`: 0.1
|
220 |
+
- `bf16`: True
|
221 |
+
- `batch_sampler`: no_duplicates
|
222 |
+
|
223 |
+
#### All Hyperparameters
|
224 |
+
<details><summary>Click to expand</summary>
|
225 |
+
|
226 |
+
- `overwrite_output_dir`: False
|
227 |
+
- `do_predict`: False
|
228 |
+
- `eval_strategy`: no
|
229 |
+
- `prediction_loss_only`: True
|
230 |
+
- `per_device_train_batch_size`: 512
|
231 |
+
- `per_device_eval_batch_size`: 8
|
232 |
+
- `per_gpu_train_batch_size`: None
|
233 |
+
- `per_gpu_eval_batch_size`: None
|
234 |
+
- `gradient_accumulation_steps`: 1
|
235 |
+
- `eval_accumulation_steps`: None
|
236 |
+
- `learning_rate`: 2e-05
|
237 |
+
- `weight_decay`: 0.0
|
238 |
+
- `adam_beta1`: 0.9
|
239 |
+
- `adam_beta2`: 0.999
|
240 |
+
- `adam_epsilon`: 1e-08
|
241 |
+
- `max_grad_norm`: 1.0
|
242 |
+
- `num_train_epochs`: 4
|
243 |
+
- `max_steps`: -1
|
244 |
+
- `lr_scheduler_type`: linear
|
245 |
+
- `lr_scheduler_kwargs`: {}
|
246 |
+
- `warmup_ratio`: 0.1
|
247 |
+
- `warmup_steps`: 0
|
248 |
+
- `log_level`: passive
|
249 |
+
- `log_level_replica`: warning
|
250 |
+
- `log_on_each_node`: True
|
251 |
+
- `logging_nan_inf_filter`: True
|
252 |
+
- `save_safetensors`: True
|
253 |
+
- `save_on_each_node`: False
|
254 |
+
- `save_only_model`: False
|
255 |
+
- `restore_callback_states_from_checkpoint`: False
|
256 |
+
- `no_cuda`: False
|
257 |
+
- `use_cpu`: False
|
258 |
+
- `use_mps_device`: False
|
259 |
+
- `seed`: 42
|
260 |
+
- `data_seed`: None
|
261 |
+
- `jit_mode_eval`: False
|
262 |
+
- `use_ipex`: False
|
263 |
+
- `bf16`: True
|
264 |
+
- `fp16`: False
|
265 |
+
- `fp16_opt_level`: O1
|
266 |
+
- `half_precision_backend`: auto
|
267 |
+
- `bf16_full_eval`: False
|
268 |
+
- `fp16_full_eval`: False
|
269 |
+
- `tf32`: None
|
270 |
+
- `local_rank`: 0
|
271 |
+
- `ddp_backend`: None
|
272 |
+
- `tpu_num_cores`: None
|
273 |
+
- `tpu_metrics_debug`: False
|
274 |
+
- `debug`: []
|
275 |
+
- `dataloader_drop_last`: False
|
276 |
+
- `dataloader_num_workers`: 0
|
277 |
+
- `dataloader_prefetch_factor`: None
|
278 |
+
- `past_index`: -1
|
279 |
+
- `disable_tqdm`: False
|
280 |
+
- `remove_unused_columns`: True
|
281 |
+
- `label_names`: None
|
282 |
+
- `load_best_model_at_end`: False
|
283 |
+
- `ignore_data_skip`: False
|
284 |
+
- `fsdp`: []
|
285 |
+
- `fsdp_min_num_params`: 0
|
286 |
+
- `fsdp_config`: {'min_num_params': 0, 'xla': False, 'xla_fsdp_v2': False, 'xla_fsdp_grad_ckpt': False}
|
287 |
+
- `fsdp_transformer_layer_cls_to_wrap`: None
|
288 |
+
- `accelerator_config`: {'split_batches': False, 'dispatch_batches': None, 'even_batches': True, 'use_seedable_sampler': True, 'non_blocking': False, 'gradient_accumulation_kwargs': None}
|
289 |
+
- `deepspeed`: None
|
290 |
+
- `label_smoothing_factor`: 0.0
|
291 |
+
- `optim`: adamw_torch
|
292 |
+
- `optim_args`: None
|
293 |
+
- `adafactor`: False
|
294 |
+
- `group_by_length`: False
|
295 |
+
- `length_column_name`: length
|
296 |
+
- `ddp_find_unused_parameters`: None
|
297 |
+
- `ddp_bucket_cap_mb`: None
|
298 |
+
- `ddp_broadcast_buffers`: False
|
299 |
+
- `dataloader_pin_memory`: True
|
300 |
+
- `dataloader_persistent_workers`: False
|
301 |
+
- `skip_memory_metrics`: True
|
302 |
+
- `use_legacy_prediction_loop`: False
|
303 |
+
- `push_to_hub`: False
|
304 |
+
- `resume_from_checkpoint`: None
|
305 |
+
- `hub_model_id`: None
|
306 |
+
- `hub_strategy`: every_save
|
307 |
+
- `hub_private_repo`: False
|
308 |
+
- `hub_always_push`: False
|
309 |
+
- `gradient_checkpointing`: False
|
310 |
+
- `gradient_checkpointing_kwargs`: None
|
311 |
+
- `include_inputs_for_metrics`: False
|
312 |
+
- `eval_do_concat_batches`: True
|
313 |
+
- `fp16_backend`: auto
|
314 |
+
- `push_to_hub_model_id`: None
|
315 |
+
- `push_to_hub_organization`: None
|
316 |
+
- `mp_parameters`:
|
317 |
+
- `auto_find_batch_size`: False
|
318 |
+
- `full_determinism`: False
|
319 |
+
- `torchdynamo`: None
|
320 |
+
- `ray_scope`: last
|
321 |
+
- `ddp_timeout`: 1800
|
322 |
+
- `torch_compile`: False
|
323 |
+
- `torch_compile_backend`: None
|
324 |
+
- `torch_compile_mode`: None
|
325 |
+
- `dispatch_batches`: None
|
326 |
+
- `split_batches`: None
|
327 |
+
- `include_tokens_per_second`: False
|
328 |
+
- `include_num_input_tokens_seen`: False
|
329 |
+
- `neftune_noise_alpha`: None
|
330 |
+
- `optim_target_modules`: None
|
331 |
+
- `batch_eval_metrics`: False
|
332 |
+
- `batch_sampler`: no_duplicates
|
333 |
+
- `multi_dataset_batch_sampler`: proportional
|
334 |
+
|
335 |
+
</details>
|
336 |
+
|
337 |
+
### Training Logs
|
338 |
+
<details><summary>Click to expand</summary>
|
339 |
+
|
340 |
+
| Epoch | Step | Training Loss | bge-micro-test_spearman_cosine |
|
341 |
+
|:------:|:-----:|:-------------:|:------------------------------:|
|
342 |
+
| 0.0159 | 100 | 6.1861 | - |
|
343 |
+
| 0.0319 | 200 | 6.0547 | - |
|
344 |
+
| 0.0478 | 300 | 5.6041 | - |
|
345 |
+
| 0.0638 | 400 | 4.9367 | - |
|
346 |
+
| 0.0797 | 500 | 4.3412 | - |
|
347 |
+
| 0.0957 | 600 | 3.8245 | - |
|
348 |
+
| 0.1116 | 700 | 3.3188 | - |
|
349 |
+
| 0.1276 | 800 | 2.869 | - |
|
350 |
+
| 0.1435 | 900 | 2.5149 | - |
|
351 |
+
| 0.1595 | 1000 | 2.2282 | - |
|
352 |
+
| 0.1754 | 1100 | 2.0046 | - |
|
353 |
+
| 0.1914 | 1200 | 1.8032 | - |
|
354 |
+
| 0.2073 | 1300 | 1.6289 | - |
|
355 |
+
| 0.2232 | 1400 | 1.4567 | - |
|
356 |
+
| 0.2392 | 1500 | 1.3326 | - |
|
357 |
+
| 0.2551 | 1600 | 1.2127 | - |
|
358 |
+
| 0.2711 | 1700 | 1.0909 | - |
|
359 |
+
| 0.2870 | 1800 | 1.0021 | - |
|
360 |
+
| 0.3030 | 1900 | 0.9135 | - |
|
361 |
+
| 0.3189 | 2000 | 0.8378 | - |
|
362 |
+
| 0.3349 | 2100 | 0.7758 | - |
|
363 |
+
| 0.3508 | 2200 | 0.7031 | - |
|
364 |
+
| 0.3668 | 2300 | 0.6418 | - |
|
365 |
+
| 0.3827 | 2400 | 0.5965 | - |
|
366 |
+
| 0.3987 | 2500 | 0.5461 | - |
|
367 |
+
| 0.4146 | 2600 | 0.5039 | - |
|
368 |
+
| 0.4306 | 2700 | 0.4674 | - |
|
369 |
+
| 0.4465 | 2800 | 0.4339 | - |
|
370 |
+
| 0.4624 | 2900 | 0.4045 | - |
|
371 |
+
| 0.4784 | 3000 | 0.373 | - |
|
372 |
+
| 0.4943 | 3100 | 0.3566 | - |
|
373 |
+
| 0.5103 | 3200 | 0.3348 | - |
|
374 |
+
| 0.5262 | 3300 | 0.3215 | - |
|
375 |
+
| 0.5422 | 3400 | 0.302 | - |
|
376 |
+
| 0.5581 | 3500 | 0.2826 | - |
|
377 |
+
| 0.5741 | 3600 | 0.2803 | - |
|
378 |
+
| 0.5900 | 3700 | 0.2616 | - |
|
379 |
+
| 0.6060 | 3800 | 0.2554 | - |
|
380 |
+
| 0.6219 | 3900 | 0.234 | - |
|
381 |
+
| 0.6379 | 4000 | 0.2306 | - |
|
382 |
+
| 0.6538 | 4100 | 0.2224 | - |
|
383 |
+
| 0.6697 | 4200 | 0.2141 | - |
|
384 |
+
| 0.6857 | 4300 | 0.2117 | - |
|
385 |
+
| 0.7016 | 4400 | 0.204 | - |
|
386 |
+
| 0.7176 | 4500 | 0.198 | - |
|
387 |
+
| 0.7335 | 4600 | 0.1986 | - |
|
388 |
+
| 0.7495 | 4700 | 0.1821 | - |
|
389 |
+
| 0.7654 | 4800 | 0.1813 | - |
|
390 |
+
| 0.7814 | 4900 | 0.1741 | - |
|
391 |
+
| 0.7973 | 5000 | 0.1697 | - |
|
392 |
+
| 0.8133 | 5100 | 0.1655 | - |
|
393 |
+
| 0.8292 | 5200 | 0.1623 | - |
|
394 |
+
| 0.8452 | 5300 | 0.1593 | - |
|
395 |
+
| 0.8611 | 5400 | 0.1566 | - |
|
396 |
+
| 0.8771 | 5500 | 0.151 | - |
|
397 |
+
| 0.8930 | 5600 | 0.1526 | - |
|
398 |
+
| 0.9089 | 5700 | 0.1453 | - |
|
399 |
+
| 0.9249 | 5800 | 0.1448 | - |
|
400 |
+
| 0.9408 | 5900 | 0.1369 | - |
|
401 |
+
| 0.9568 | 6000 | 0.1409 | - |
|
402 |
+
| 0.9727 | 6100 | 0.1373 | - |
|
403 |
+
| 0.9887 | 6200 | 0.133 | - |
|
404 |
+
| 1.0046 | 6300 | 0.1269 | - |
|
405 |
+
| 1.0206 | 6400 | 0.1274 | - |
|
406 |
+
| 1.0365 | 6500 | 0.1271 | - |
|
407 |
+
| 1.0525 | 6600 | 0.1216 | - |
|
408 |
+
| 1.0684 | 6700 | 0.1176 | - |
|
409 |
+
| 1.0844 | 6800 | 0.1208 | - |
|
410 |
+
| 1.1003 | 6900 | 0.1177 | - |
|
411 |
+
| 1.1162 | 7000 | 0.1175 | - |
|
412 |
+
| 1.1322 | 7100 | 0.1109 | - |
|
413 |
+
| 1.1481 | 7200 | 0.1118 | - |
|
414 |
+
| 1.1641 | 7300 | 0.1085 | - |
|
415 |
+
| 1.1800 | 7400 | 0.1155 | - |
|
416 |
+
| 1.1960 | 7500 | 0.1079 | - |
|
417 |
+
| 1.2119 | 7600 | 0.1087 | - |
|
418 |
+
| 1.2279 | 7700 | 0.1004 | - |
|
419 |
+
| 1.2438 | 7800 | 0.1084 | - |
|
420 |
+
| 1.2598 | 7900 | 0.1089 | - |
|
421 |
+
| 1.2757 | 8000 | 0.1012 | - |
|
422 |
+
| 1.2917 | 8100 | 0.1037 | - |
|
423 |
+
| 1.3076 | 8200 | 0.1004 | - |
|
424 |
+
| 1.3236 | 8300 | 0.0979 | - |
|
425 |
+
| 1.3395 | 8400 | 0.1007 | - |
|
426 |
+
| 1.3554 | 8500 | 0.0956 | - |
|
427 |
+
| 1.3714 | 8600 | 0.0972 | - |
|
428 |
+
| 1.3873 | 8700 | 0.0947 | - |
|
429 |
+
| 1.4033 | 8800 | 0.0931 | - |
|
430 |
+
| 1.4192 | 8900 | 0.0948 | - |
|
431 |
+
| 1.4352 | 9000 | 0.0925 | - |
|
432 |
+
| 1.4511 | 9100 | 0.0933 | - |
|
433 |
+
| 1.4671 | 9200 | 0.0888 | - |
|
434 |
+
| 1.4830 | 9300 | 0.0877 | - |
|
435 |
+
| 1.4990 | 9400 | 0.0889 | - |
|
436 |
+
| 1.5149 | 9500 | 0.0895 | - |
|
437 |
+
| 1.5309 | 9600 | 0.0892 | - |
|
438 |
+
| 1.5468 | 9700 | 0.089 | - |
|
439 |
+
| 1.5627 | 9800 | 0.0828 | - |
|
440 |
+
| 1.5787 | 9900 | 0.0906 | - |
|
441 |
+
| 1.5946 | 10000 | 0.0893 | - |
|
442 |
+
| 1.6106 | 10100 | 0.0849 | - |
|
443 |
+
| 1.6265 | 10200 | 0.0811 | - |
|
444 |
+
| 1.6425 | 10300 | 0.0823 | - |
|
445 |
+
| 1.6584 | 10400 | 0.0806 | - |
|
446 |
+
| 1.6744 | 10500 | 0.0815 | - |
|
447 |
+
| 1.6903 | 10600 | 0.0832 | - |
|
448 |
+
| 1.7063 | 10700 | 0.0856 | - |
|
449 |
+
| 1.7222 | 10800 | 0.081 | - |
|
450 |
+
| 1.7382 | 10900 | 0.0831 | - |
|
451 |
+
| 1.7541 | 11000 | 0.0767 | - |
|
452 |
+
| 1.7701 | 11100 | 0.0779 | - |
|
453 |
+
| 1.7860 | 11200 | 0.0792 | - |
|
454 |
+
| 1.8019 | 11300 | 0.0771 | - |
|
455 |
+
| 1.8179 | 11400 | 0.0783 | - |
|
456 |
+
| 1.8338 | 11500 | 0.0749 | - |
|
457 |
+
| 1.8498 | 11600 | 0.0755 | - |
|
458 |
+
| 1.8657 | 11700 | 0.0778 | - |
|
459 |
+
| 1.8817 | 11800 | 0.0753 | - |
|
460 |
+
| 1.8976 | 11900 | 0.0767 | - |
|
461 |
+
| 1.9136 | 12000 | 0.0725 | - |
|
462 |
+
| 1.9295 | 12100 | 0.0744 | - |
|
463 |
+
| 1.9455 | 12200 | 0.0743 | - |
|
464 |
+
| 1.9614 | 12300 | 0.0722 | - |
|
465 |
+
| 1.9774 | 12400 | 0.0712 | - |
|
466 |
+
| 1.9933 | 12500 | 0.0709 | - |
|
467 |
+
| 2.0092 | 12600 | 0.0694 | - |
|
468 |
+
| 2.0252 | 12700 | 0.0705 | - |
|
469 |
+
| 2.0411 | 12800 | 0.0715 | - |
|
470 |
+
| 2.0571 | 12900 | 0.0705 | - |
|
471 |
+
| 2.0730 | 13000 | 0.0653 | - |
|
472 |
+
| 2.0890 | 13100 | 0.0698 | - |
|
473 |
+
| 2.1049 | 13200 | 0.0676 | - |
|
474 |
+
| 2.1209 | 13300 | 0.0684 | - |
|
475 |
+
| 2.1368 | 13400 | 0.0644 | - |
|
476 |
+
| 2.1528 | 13500 | 0.0652 | - |
|
477 |
+
| 2.1687 | 13600 | 0.0673 | - |
|
478 |
+
| 2.1847 | 13700 | 0.067 | - |
|
479 |
+
| 2.2006 | 13800 | 0.0645 | - |
|
480 |
+
| 2.2166 | 13900 | 0.0633 | - |
|
481 |
+
| 2.2325 | 14000 | 0.0645 | - |
|
482 |
+
| 2.2484 | 14100 | 0.0698 | - |
|
483 |
+
| 2.2644 | 14200 | 0.0655 | - |
|
484 |
+
| 2.2803 | 14300 | 0.0654 | - |
|
485 |
+
| 2.2963 | 14400 | 0.0656 | - |
|
486 |
+
| 2.3122 | 14500 | 0.0631 | - |
|
487 |
+
| 2.3282 | 14600 | 0.0628 | - |
|
488 |
+
| 2.3441 | 14700 | 0.0671 | - |
|
489 |
+
| 2.3601 | 14800 | 0.0659 | - |
|
490 |
+
| 2.3760 | 14900 | 0.0619 | - |
|
491 |
+
| 2.3920 | 15000 | 0.0618 | - |
|
492 |
+
| 2.4079 | 15100 | 0.0624 | - |
|
493 |
+
| 2.4239 | 15200 | 0.0616 | - |
|
494 |
+
| 2.4398 | 15300 | 0.0631 | - |
|
495 |
+
| 2.4557 | 15400 | 0.0639 | - |
|
496 |
+
| 2.4717 | 15500 | 0.0585 | - |
|
497 |
+
| 2.4876 | 15600 | 0.0607 | - |
|
498 |
+
| 2.5036 | 15700 | 0.0615 | - |
|
499 |
+
| 2.5195 | 15800 | 0.062 | - |
|
500 |
+
| 2.5355 | 15900 | 0.0621 | - |
|
501 |
+
| 2.5514 | 16000 | 0.0608 | - |
|
502 |
+
| 2.5674 | 16100 | 0.0594 | - |
|
503 |
+
| 2.5833 | 16200 | 0.0631 | - |
|
504 |
+
| 2.5993 | 16300 | 0.0635 | - |
|
505 |
+
| 2.6152 | 16400 | 0.06 | - |
|
506 |
+
| 2.6312 | 16500 | 0.0581 | - |
|
507 |
+
| 2.6471 | 16600 | 0.0607 | - |
|
508 |
+
| 2.6631 | 16700 | 0.0577 | - |
|
509 |
+
| 2.6790 | 16800 | 0.0592 | - |
|
510 |
+
| 2.6949 | 16900 | 0.0625 | - |
|
511 |
+
| 2.7109 | 17000 | 0.0622 | - |
|
512 |
+
| 2.7268 | 17100 | 0.0573 | - |
|
513 |
+
| 2.7428 | 17200 | 0.0613 | - |
|
514 |
+
| 2.7587 | 17300 | 0.0587 | - |
|
515 |
+
| 2.7747 | 17400 | 0.0587 | - |
|
516 |
+
| 2.7906 | 17500 | 0.0588 | - |
|
517 |
+
| 2.8066 | 17600 | 0.0568 | - |
|
518 |
+
| 2.8225 | 17700 | 0.0573 | - |
|
519 |
+
| 2.8385 | 17800 | 0.0575 | - |
|
520 |
+
| 2.8544 | 17900 | 0.0575 | - |
|
521 |
+
| 2.8704 | 18000 | 0.0582 | - |
|
522 |
+
| 2.8863 | 18100 | 0.0577 | - |
|
523 |
+
| 2.9022 | 18200 | 0.057 | - |
|
524 |
+
| 2.9182 | 18300 | 0.0572 | - |
|
525 |
+
| 2.9341 | 18400 | 0.0558 | - |
|
526 |
+
| 2.9501 | 18500 | 0.0578 | - |
|
527 |
+
| 2.9660 | 18600 | 0.0567 | - |
|
528 |
+
| 2.9820 | 18700 | 0.0569 | - |
|
529 |
+
| 2.9979 | 18800 | 0.0547 | - |
|
530 |
+
| 3.0139 | 18900 | 0.0542 | - |
|
531 |
+
| 3.0298 | 19000 | 0.0563 | - |
|
532 |
+
| 3.0458 | 19100 | 0.0549 | - |
|
533 |
+
| 3.0617 | 19200 | 0.0531 | - |
|
534 |
+
| 3.0777 | 19300 | 0.053 | - |
|
535 |
+
| 3.0936 | 19400 | 0.0557 | - |
|
536 |
+
| 3.1096 | 19500 | 0.0546 | - |
|
537 |
+
| 3.1255 | 19600 | 0.0518 | - |
|
538 |
+
| 3.1414 | 19700 | 0.0517 | - |
|
539 |
+
| 3.1574 | 19800 | 0.0528 | - |
|
540 |
+
| 3.1733 | 19900 | 0.0551 | - |
|
541 |
+
| 3.1893 | 20000 | 0.0544 | - |
|
542 |
+
| 3.2052 | 20100 | 0.0526 | - |
|
543 |
+
| 3.2212 | 20200 | 0.0494 | - |
|
544 |
+
| 3.2371 | 20300 | 0.0537 | - |
|
545 |
+
| 3.2531 | 20400 | 0.0568 | - |
|
546 |
+
| 3.2690 | 20500 | 0.0525 | - |
|
547 |
+
| 3.2850 | 20600 | 0.0566 | - |
|
548 |
+
| 3.3009 | 20700 | 0.0539 | - |
|
549 |
+
| 3.3169 | 20800 | 0.0531 | - |
|
550 |
+
| 3.3328 | 20900 | 0.0524 | - |
|
551 |
+
| 3.3487 | 21000 | 0.0543 | - |
|
552 |
+
| 3.3647 | 21100 | 0.0537 | - |
|
553 |
+
| 3.3806 | 21200 | 0.0524 | - |
|
554 |
+
| 3.3966 | 21300 | 0.0516 | - |
|
555 |
+
| 3.4125 | 21400 | 0.0537 | - |
|
556 |
+
| 3.4285 | 21500 | 0.0515 | - |
|
557 |
+
| 3.4444 | 21600 | 0.0537 | - |
|
558 |
+
| 3.4604 | 21700 | 0.0526 | - |
|
559 |
+
| 3.4763 | 21800 | 0.0508 | - |
|
560 |
+
| 3.4923 | 21900 | 0.0526 | - |
|
561 |
+
| 3.5082 | 22000 | 0.0521 | - |
|
562 |
+
| 3.5242 | 22100 | 0.054 | - |
|
563 |
+
| 3.5401 | 22200 | 0.053 | - |
|
564 |
+
| 3.5561 | 22300 | 0.0509 | - |
|
565 |
+
| 3.5720 | 22400 | 0.0526 | - |
|
566 |
+
| 3.5879 | 22500 | 0.0551 | - |
|
567 |
+
| 3.6039 | 22600 | 0.0556 | - |
|
568 |
+
| 3.6198 | 22700 | 0.0497 | - |
|
569 |
+
| 3.6358 | 22800 | 0.0515 | - |
|
570 |
+
| 3.6517 | 22900 | 0.0514 | - |
|
571 |
+
| 3.6677 | 23000 | 0.0503 | - |
|
572 |
+
| 3.6836 | 23100 | 0.0515 | - |
|
573 |
+
| 3.6996 | 23200 | 0.0553 | - |
|
574 |
+
| 3.7155 | 23300 | 0.0519 | - |
|
575 |
+
| 3.7315 | 23400 | 0.0549 | - |
|
576 |
+
| 3.7474 | 23500 | 0.0522 | - |
|
577 |
+
| 3.7634 | 23600 | 0.0526 | - |
|
578 |
+
| 3.7793 | 23700 | 0.0525 | - |
|
579 |
+
| 3.7952 | 23800 | 0.051 | - |
|
580 |
+
| 3.8112 | 23900 | 0.0509 | - |
|
581 |
+
| 3.8271 | 24000 | 0.0503 | - |
|
582 |
+
| 3.8431 | 24100 | 0.0524 | - |
|
583 |
+
| 3.8590 | 24200 | 0.0526 | - |
|
584 |
+
| 3.8750 | 24300 | 0.0512 | - |
|
585 |
+
| 3.8909 | 24400 | 0.0518 | - |
|
586 |
+
| 3.9069 | 24500 | 0.0521 | - |
|
587 |
+
| 3.9228 | 24600 | 0.0524 | - |
|
588 |
+
| 3.9388 | 24700 | 0.051 | - |
|
589 |
+
| 3.9547 | 24800 | 0.0535 | - |
|
590 |
+
| 3.9707 | 24900 | 0.0508 | - |
|
591 |
+
| 3.9866 | 25000 | 0.0514 | - |
|
592 |
+
| 4.0 | 25084 | - | nan |
|
593 |
+
|
594 |
+
</details>
|
595 |
+
|
596 |
+
### Framework Versions
|
597 |
+
- Python: 3.10.9
|
598 |
+
- Sentence Transformers: 3.0.1
|
599 |
+
- Transformers: 4.41.2
|
600 |
+
- PyTorch: 2.4.1+cu124
|
601 |
+
- Accelerate: 0.33.0
|
602 |
+
- Datasets: 2.18.0
|
603 |
+
- Tokenizers: 0.19.1
|
604 |
+
|
605 |
+
## Citation
|
606 |
+
|
607 |
+
### BibTeX
|
608 |
+
|
609 |
+
#### Sentence Transformers
|
610 |
+
```bibtex
|
611 |
+
@inproceedings{reimers-2019-sentence-bert,
|
612 |
+
title = "Sentence-BERT: Sentence Embeddings using Siamese BERT-Networks",
|
613 |
+
author = "Reimers, Nils and Gurevych, Iryna",
|
614 |
+
booktitle = "Proceedings of the 2019 Conference on Empirical Methods in Natural Language Processing",
|
615 |
+
month = "11",
|
616 |
+
year = "2019",
|
617 |
+
publisher = "Association for Computational Linguistics",
|
618 |
+
url = "https://arxiv.org/abs/1908.10084",
|
619 |
+
}
|
620 |
+
```
|
621 |
+
|
622 |
+
#### CachedMultipleNegativesRankingLoss
|
623 |
+
```bibtex
|
624 |
+
@misc{gao2021scaling,
|
625 |
+
title={Scaling Deep Contrastive Learning Batch Size under Memory Limited Setup},
|
626 |
+
author={Luyu Gao and Yunyi Zhang and Jiawei Han and Jamie Callan},
|
627 |
+
year={2021},
|
628 |
+
eprint={2101.06983},
|
629 |
+
archivePrefix={arXiv},
|
630 |
+
primaryClass={cs.LG}
|
631 |
+
}
|
632 |
+
```
|
633 |
+
|
634 |
+
<!--
|
635 |
+
## Glossary
|
636 |
+
|
637 |
+
*Clearly define terms in order to be accessible across audiences.*
|
638 |
+
-->
|
639 |
+
|
640 |
+
<!--
|
641 |
+
## Model Card Authors
|
642 |
+
|
643 |
+
*Lists the people who create the model card, providing recognition and accountability for the detailed work that goes into its construction.*
|
644 |
+
-->
|
645 |
+
|
646 |
+
<!--
|
647 |
+
## Model Card Contact
|
648 |
+
|
649 |
+
*Provides a way for people who have updates to the Model Card, suggestions, or questions, to contact the Model Card authors.*
|
650 |
+
-->
|
config.json
ADDED
@@ -0,0 +1,31 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
{
|
2 |
+
"_name_or_path": "TaylorAI/bge-micro",
|
3 |
+
"architectures": [
|
4 |
+
"BertModel"
|
5 |
+
],
|
6 |
+
"attention_probs_dropout_prob": 0.1,
|
7 |
+
"classifier_dropout": null,
|
8 |
+
"hidden_act": "gelu",
|
9 |
+
"hidden_dropout_prob": 0.1,
|
10 |
+
"hidden_size": 384,
|
11 |
+
"id2label": {
|
12 |
+
"0": "LABEL_0"
|
13 |
+
},
|
14 |
+
"initializer_range": 0.02,
|
15 |
+
"intermediate_size": 1536,
|
16 |
+
"label2id": {
|
17 |
+
"LABEL_0": 0
|
18 |
+
},
|
19 |
+
"layer_norm_eps": 1e-12,
|
20 |
+
"max_position_embeddings": 512,
|
21 |
+
"model_type": "bert",
|
22 |
+
"num_attention_heads": 12,
|
23 |
+
"num_hidden_layers": 3,
|
24 |
+
"pad_token_id": 0,
|
25 |
+
"position_embedding_type": "absolute",
|
26 |
+
"torch_dtype": "float32",
|
27 |
+
"transformers_version": "4.41.2",
|
28 |
+
"type_vocab_size": 2,
|
29 |
+
"use_cache": true,
|
30 |
+
"vocab_size": 30522
|
31 |
+
}
|
config_sentence_transformers.json
ADDED
@@ -0,0 +1,10 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
{
|
2 |
+
"__version__": {
|
3 |
+
"sentence_transformers": "3.0.1",
|
4 |
+
"transformers": "4.41.2",
|
5 |
+
"pytorch": "2.4.1+cu124"
|
6 |
+
},
|
7 |
+
"prompts": {},
|
8 |
+
"default_prompt_name": null,
|
9 |
+
"similarity_fn_name": null
|
10 |
+
}
|
model.safetensors
ADDED
@@ -0,0 +1,3 @@
|
|
|
|
|
|
|
|
|
1 |
+
version https://git-lfs.github.com/spec/v1
|
2 |
+
oid sha256:a541ec23496186c0156be8884fc68df90fc7f4a0a2c777fbf0a6229dc2985d5f
|
3 |
+
size 69565312
|
modules.json
ADDED
@@ -0,0 +1,14 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
[
|
2 |
+
{
|
3 |
+
"idx": 0,
|
4 |
+
"name": "0",
|
5 |
+
"path": "",
|
6 |
+
"type": "sentence_transformers.models.Transformer"
|
7 |
+
},
|
8 |
+
{
|
9 |
+
"idx": 1,
|
10 |
+
"name": "1",
|
11 |
+
"path": "1_Pooling",
|
12 |
+
"type": "sentence_transformers.models.Pooling"
|
13 |
+
}
|
14 |
+
]
|
sentence_bert_config.json
ADDED
@@ -0,0 +1,4 @@
|
|
|
|
|
|
|
|
|
|
|
1 |
+
{
|
2 |
+
"max_seq_length": 512,
|
3 |
+
"do_lower_case": false
|
4 |
+
}
|
special_tokens_map.json
ADDED
@@ -0,0 +1,44 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
{
|
2 |
+
"additional_special_tokens": [
|
3 |
+
"[PAD]",
|
4 |
+
"[UNK]",
|
5 |
+
"[CLS]",
|
6 |
+
"[SEP]",
|
7 |
+
"[MASK]"
|
8 |
+
],
|
9 |
+
"cls_token": {
|
10 |
+
"content": "[CLS]",
|
11 |
+
"lstrip": false,
|
12 |
+
"normalized": false,
|
13 |
+
"rstrip": false,
|
14 |
+
"single_word": false
|
15 |
+
},
|
16 |
+
"mask_token": {
|
17 |
+
"content": "[MASK]",
|
18 |
+
"lstrip": false,
|
19 |
+
"normalized": false,
|
20 |
+
"rstrip": false,
|
21 |
+
"single_word": false
|
22 |
+
},
|
23 |
+
"pad_token": {
|
24 |
+
"content": "[PAD]",
|
25 |
+
"lstrip": false,
|
26 |
+
"normalized": false,
|
27 |
+
"rstrip": false,
|
28 |
+
"single_word": false
|
29 |
+
},
|
30 |
+
"sep_token": {
|
31 |
+
"content": "[SEP]",
|
32 |
+
"lstrip": false,
|
33 |
+
"normalized": false,
|
34 |
+
"rstrip": false,
|
35 |
+
"single_word": false
|
36 |
+
},
|
37 |
+
"unk_token": {
|
38 |
+
"content": "[UNK]",
|
39 |
+
"lstrip": false,
|
40 |
+
"normalized": false,
|
41 |
+
"rstrip": false,
|
42 |
+
"single_word": false
|
43 |
+
}
|
44 |
+
}
|
tokenizer.json
ADDED
The diff for this file is too large to render.
See raw diff
|
|
tokenizer_config.json
ADDED
@@ -0,0 +1,71 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
{
|
2 |
+
"added_tokens_decoder": {
|
3 |
+
"0": {
|
4 |
+
"content": "[PAD]",
|
5 |
+
"lstrip": false,
|
6 |
+
"normalized": false,
|
7 |
+
"rstrip": false,
|
8 |
+
"single_word": false,
|
9 |
+
"special": true
|
10 |
+
},
|
11 |
+
"100": {
|
12 |
+
"content": "[UNK]",
|
13 |
+
"lstrip": false,
|
14 |
+
"normalized": false,
|
15 |
+
"rstrip": false,
|
16 |
+
"single_word": false,
|
17 |
+
"special": true
|
18 |
+
},
|
19 |
+
"101": {
|
20 |
+
"content": "[CLS]",
|
21 |
+
"lstrip": false,
|
22 |
+
"normalized": false,
|
23 |
+
"rstrip": false,
|
24 |
+
"single_word": false,
|
25 |
+
"special": true
|
26 |
+
},
|
27 |
+
"102": {
|
28 |
+
"content": "[SEP]",
|
29 |
+
"lstrip": false,
|
30 |
+
"normalized": false,
|
31 |
+
"rstrip": false,
|
32 |
+
"single_word": false,
|
33 |
+
"special": true
|
34 |
+
},
|
35 |
+
"103": {
|
36 |
+
"content": "[MASK]",
|
37 |
+
"lstrip": false,
|
38 |
+
"normalized": false,
|
39 |
+
"rstrip": false,
|
40 |
+
"single_word": false,
|
41 |
+
"special": true
|
42 |
+
}
|
43 |
+
},
|
44 |
+
"additional_special_tokens": [
|
45 |
+
"[PAD]",
|
46 |
+
"[UNK]",
|
47 |
+
"[CLS]",
|
48 |
+
"[SEP]",
|
49 |
+
"[MASK]"
|
50 |
+
],
|
51 |
+
"clean_up_tokenization_spaces": true,
|
52 |
+
"cls_token": "[CLS]",
|
53 |
+
"do_basic_tokenize": true,
|
54 |
+
"do_lower_case": true,
|
55 |
+
"mask_token": "[MASK]",
|
56 |
+
"max_length": 512,
|
57 |
+
"model_max_length": 512,
|
58 |
+
"never_split": null,
|
59 |
+
"pad_to_multiple_of": null,
|
60 |
+
"pad_token": "[PAD]",
|
61 |
+
"pad_token_type_id": 0,
|
62 |
+
"padding_side": "right",
|
63 |
+
"sep_token": "[SEP]",
|
64 |
+
"stride": 0,
|
65 |
+
"strip_accents": null,
|
66 |
+
"tokenize_chinese_chars": true,
|
67 |
+
"tokenizer_class": "BertTokenizer",
|
68 |
+
"truncation_side": "right",
|
69 |
+
"truncation_strategy": "longest_first",
|
70 |
+
"unk_token": "[UNK]"
|
71 |
+
}
|
vocab.txt
ADDED
The diff for this file is too large to render.
See raw diff
|
|