Spaces:

simonduerr
/

diffdock

Sleeping

App Files Files Community

Simon Duerr commited on Oct 10, 2022

Commit

334e3a1

•

1 Parent(s): d40328c

add test set examples

Browse files

Files changed (9) hide show

app.py +135 -49
esm/LICENSE +21 -0
esm/scripts/extract.py +1 -1
examples/6ahs_ligand.sdf +97 -0
examples/6ahs_protein_processed.pdb +0 -0
examples/6o5u_ligand.sdf +154 -0
examples/6o5u_protein_processed.pdb +0 -0
examples/6w70.pdb +0 -0
examples/6w70_ligand.sdf +170 -0

app.py CHANGED Viewed

@@ -15,6 +15,10 @@ from rdkit import RDLogger
 from rdkit.Chem import MolFromSmiles, AddHs
 from torch_geometric.loader import DataLoader
 import yaml
 print(torch.__version__)
 os.makedirs("data/esm2_output", exist_ok=True)
@@ -41,6 +45,8 @@ with open(f"workdir/paper_score_model/model_parameters.yml") as f:
 with open(f"workdir/paper_confidence_model/model_parameters.yml") as f:
     confidence_args = Namespace(**yaml.full_load(f))
 t_to_sigma = partial(t_to_sigma_compl, args=score_model_args)
 model = get_model(score_model_args, device, t_to_sigma=t_to_sigma, no_parallel=True)
@@ -66,30 +72,17 @@ state_dict = torch.load(
 confidence_model.load_state_dict(state_dict, strict=True)
 confidence_model = confidence_model.to(device)
 confidence_model.eval()
-tr_schedule = get_t_schedule(inference_steps=10)
-rot_schedule = tr_schedule
-tor_schedule = tr_schedule
-print("common t schedule", tr_schedule)
-failures, skipped, confidences_list, names_list, run_times, min_self_distances_list = (
-    0,
-    0,
-    [],
-    [],
-    [],
-    [],
-)
-N = 10
 def get_pdb(pdb_code="", filepath=""):
-    if pdb_code is None or pdb_code == "":
-        try:
-            return filepath.name
-        except AttributeError as e:
             return None
-    else:
-        os.system(f"wget -qnc https://files.rcsb.org/view/{pdb_code}.pdb")
-        return f"{pdb_code}.pdb"
 def get_ligand(smiles="", filepath=""):
@@ -111,11 +104,23 @@ def read_mol(molpath):
     return mol
-def molecule(input_pdb, ligand_pdb):
     structure = read_mol(input_pdb)
     mol = read_mol(ligand_pdb)
     x = (
         """<!DOCTYPE html>
         <html>
@@ -134,11 +139,27 @@ def molecule(input_pdb, ligand_pdb):
     .mol-container select{
         background-image:None;
     }
     </style>
     <script src="https://3Dmol.csb.pitt.edu/build/3Dmol-min.js"></script>
     </head>
     <body>
-     <button id="startanimation">Replay diffusion process</button>
     <div id="container" class="mol-container"></div>
             <script>
@@ -147,7 +168,10 @@ def molecule(input_pdb, ligand_pdb):
         + """`
         let structure = `"""
         + structure
-        + """`
              let viewer = null;
@@ -163,6 +187,9 @@ def molecule(input_pdb, ligand_pdb):
                 viewer.animate({loop: "forward",reps: 1});
                 viewer.getModel(1).setStyle({stick:{colorscheme:"magentaCarbon"}});
                 viewer.render();
               })
@@ -189,18 +216,14 @@ def esm(protein_path, out_file):
     esm_embedding_prep(out_file, protein_path)
     # create args object with defaults
     os.environ["HOME"] = "esm/model_weights"
-    print("calling ", sys.executable)
-    print("datadir", os.listdir("data"))
-    print(os.environ)
-    print(torch.__file__)
     subprocess.call(
         f"python esm/scripts/extract.py esm2_t33_650M_UR50D {out_file} data/esm2_output --repr_layers 33 --include per_tok",
         shell=True,
-        env=os.environ
     )
-def update(inp, file, ligand_inp, ligand_file):
     pdb_path = get_pdb(inp, file)
     ligand_path = get_ligand(ligand_inp, ligand_file)
@@ -208,7 +231,26 @@ def update(inp, file, ligand_inp, ligand_file):
         pdb_path,
         f"data/{os.path.basename(pdb_path)}_prepared_for_esm.fasta",
     )
     protein_path_list = [pdb_path]
     ligand_descriptions = [ligand_path]
     no_random = False
@@ -320,7 +362,7 @@ def update(inp, file, ligand_inp, ligand_file):
             data_list, confidence = sampling(
                 data_list=data_list,
                 model=model,
-                inference_steps=10,
                 tr_schedule=tr_schedule,
                 rot_schedule=rot_schedule,
                 tor_schedule=tor_schedule,
@@ -359,6 +401,7 @@ def update(inp, file, ligand_inp, ligand_file):
                 f'{out_dir}/index{idx}_{data_list[0]["name"][0].replace("/","-")}'
             )
             os.makedirs(write_dir, exist_ok=True)
             for rank, pos in enumerate(ligand_pos):
                 mol_pred = copy.deepcopy(lig)
                 if score_model_args.remove_hs:
@@ -367,6 +410,7 @@ def update(inp, file, ligand_inp, ligand_file):
                     write_mol_with_coords(
                         mol_pred, pos, os.path.join(write_dir, f"rank{rank+1}.sdf")
                     )
                 write_mol_with_coords(
                     mol_pred,
                     pos,
@@ -404,19 +448,27 @@ def update(inp, file, ligand_inp, ligand_file):
             print("Failed on", orig_complex_graph["name"], e)
             failures += 1
             return None
-    labels = [f"rank {i+1}" for i in range(len(filenames))]
     return (
-        molecule(pdb_path, filenames[0]),
-        gr.Dropdown.update(choices=labels, value="rank 1"),
         filenames,
         pdb_path,
     )
-def updateView(out, filenames, pdb):
-    i = int(out.replace("rank", ""))
-    return molecule(pdb, filenames[i])
 demo = gr.Blocks()
@@ -426,7 +478,7 @@ with demo:
     gr.Markdown(
         ">**DiffDock: Diffusion Steps, Twists, and Turns for Molecular Docking**, Corso, Gabriele and Stärk, Hannes and Jing, Bowen and Barzilay, Regina and Jaakkola, Tommi, arXiv:2210.01776  [GitHub](https://github.com/gcorso/diffdock)"
     )
-    gr.Markdown("Runs the diffusion model `10` times with `10` inference steps")
     with gr.Box():
         with gr.Row():
             with gr.Column():
@@ -442,6 +494,9 @@ with demo:
                     label="SMILES string",
                 )
                 ligand_file = gr.File(file_count="single", label="Input Ligand")
     btn = gr.Button("Run predictions")
@@ -450,23 +505,54 @@ with demo:
     filenames = gr.Variable()
     out = gr.Dropdown(interactive=True, label="Ranked samples")
     mol = gr.HTML()
     gr.Examples(
         [
             [
-                None,
-                "examples/1a46_protein_processed.pdb",
-                None,
-                "examples/1a46_ligand.sdf",
-            ]
         ],
-        [inp, file, ligand_inp, ligand_file],
-        [mol, out],
         # cache_examples=True,
     )
     btn.click(
         fn=update,
-        inputs=[inp, file, ligand_inp, ligand_file],
-        outputs=[mol, out, filenames, pdb],
     )
-    out.change(fn=updateView, inputs=[out, filenames, pdb], outputs=mol)
 demo.launch()

 from rdkit.Chem import MolFromSmiles, AddHs
 from torch_geometric.loader import DataLoader
 import yaml
+import sys
+import csv
+csv.field_size_limit(sys.maxsize)
 print(torch.__version__)
 os.makedirs("data/esm2_output", exist_ok=True)
 with open(f"workdir/paper_confidence_model/model_parameters.yml") as f:
     confidence_args = Namespace(**yaml.full_load(f))
+import shutil
 t_to_sigma = partial(t_to_sigma_compl, args=score_model_args)
 model = get_model(score_model_args, device, t_to_sigma=t_to_sigma, no_parallel=True)
 confidence_model.load_state_dict(state_dict, strict=True)
 confidence_model = confidence_model.to(device)
 confidence_model.eval()
 def get_pdb(pdb_code="", filepath=""):
+    try:
+        return filepath.name
+    except AttributeError as e:
+        if pdb_code is None or pdb_code == "":
             return None
+        else:
+            os.system(f"wget -qnc https://files.rcsb.org/view/{pdb_code}.pdb")
+            return f"{pdb_code}.pdb"
 def get_ligand(smiles="", filepath=""):
     return mol
+def molecule(input_pdb, ligand_pdb, original_ligand):
     structure = read_mol(input_pdb)
     mol = read_mol(ligand_pdb)
+    try:
+        ligand = read_mol(original_ligand.name)
+        _, ext = os.path.splitext(original_ligand.name)
+        lig_str_1 = """let original_ligand = `""" + ligand + """`"""
+        lig_str_2 = f"""
+        viewer.addModel( original_ligand, "{ext[1:]}" );
+        viewer.getModel(2).setStyle({{stick:{{colorscheme:"greenCarbon"}}}});"""
+    except AttributeError as e:
+        ligand = None
+        lig_str_1 = ""
+        lig_str_2 = ""
     x = (
         """<!DOCTYPE html>
         <html>
     .mol-container select{
         background-image:None;
     }
+    .green{
+        width:20px;
+        height:20px;
+        background-color:#33ff45;
+        display:inline-block;
+    }
+    .magenta{
+        width:20px;
+        height:20px;
+        background-color:magenta;
+        display:inline-block;
+    }
     </style>
     <script src="https://3Dmol.csb.pitt.edu/build/3Dmol-min.js"></script>
     </head>
     <body>
+     <button id="startanimation">Replay diffusion process</button>
+     <div>
+     <span class="green"></span> Uploaded ligand position
+     <span class="magenta"></span> Predicted ligand position
+     </div>
     <div id="container" class="mol-container"></div>
             <script>
         + """`
         let structure = `"""
         + structure
+        + """`
+        """
+        + lig_str_1
+        + """
              let viewer = null;
                 viewer.animate({loop: "forward",reps: 1});
                 viewer.getModel(1).setStyle({stick:{colorscheme:"magentaCarbon"}});
+                """
+        + lig_str_2
+        + """
                 viewer.render();
               })
     esm_embedding_prep(out_file, protein_path)
     # create args object with defaults
     os.environ["HOME"] = "esm/model_weights"
     subprocess.call(
         f"python esm/scripts/extract.py esm2_t33_650M_UR50D {out_file} data/esm2_output --repr_layers 33 --include per_tok",
         shell=True,
+        env=os.environ,
     )
+def update(inp, file, ligand_inp, ligand_file, n_it):
     pdb_path = get_pdb(inp, file)
     ligand_path = get_ligand(ligand_inp, ligand_file)
         pdb_path,
         f"data/{os.path.basename(pdb_path)}_prepared_for_esm.fasta",
     )
+    tr_schedule = get_t_schedule(inference_steps=n_it)
+    rot_schedule = tr_schedule
+    tor_schedule = tr_schedule
+    print("common t schedule", tr_schedule)
+    (
+        failures,
+        skipped,
+        confidences_list,
+        names_list,
+        run_times,
+        min_self_distances_list,
+    ) = (
+        0,
+        0,
+        [],
+        [],
+        [],
+        [],
+    )
+    N = 10  # number of samples to generate
     protein_path_list = [pdb_path]
     ligand_descriptions = [ligand_path]
     no_random = False
             data_list, confidence = sampling(
                 data_list=data_list,
                 model=model,
+                inference_steps=n_it,
                 tr_schedule=tr_schedule,
                 rot_schedule=rot_schedule,
                 tor_schedule=tor_schedule,
                 f'{out_dir}/index{idx}_{data_list[0]["name"][0].replace("/","-")}'
             )
             os.makedirs(write_dir, exist_ok=True)
+            confidences = []
             for rank, pos in enumerate(ligand_pos):
                 mol_pred = copy.deepcopy(lig)
                 if score_model_args.remove_hs:
                     write_mol_with_coords(
                         mol_pred, pos, os.path.join(write_dir, f"rank{rank+1}.sdf")
                     )
+                confidences.append(confidence[rank])
                 write_mol_with_coords(
                     mol_pred,
                     pos,
             print("Failed on", orig_complex_graph["name"], e)
             failures += 1
             return None
+    # zip outputs
+    zippath = shutil.make_archive(pdb_path, "zip", write_dir)
+    print("Zipped outputs to", zippath)
+    labels = [
+        f"rank {i+1}, confidence {confidences[i]:.2f}" for i in range(len(filenames))
+    ]
     return (
+        molecule(pdb_path, filenames[0], ligand_file),
+        gr.Dropdown.update(choices=labels, value=labels[0]),
         filenames,
         pdb_path,
+        zippath,
     )
+def updateView(out, filenames, pdb, ligand_file):
+    print("updating view")
+    i = out  # int(out.replace("rank", ""))
+    print(i)
+    i = int(i.split(",")[0].replace("rank", "")) - 1
+    return molecule(pdb, filenames[i], ligand_file)
 demo = gr.Blocks()
     gr.Markdown(
         ">**DiffDock: Diffusion Steps, Twists, and Turns for Molecular Docking**, Corso, Gabriele and Stärk, Hannes and Jing, Bowen and Barzilay, Regina and Jaakkola, Tommi, arXiv:2210.01776  [GitHub](https://github.com/gcorso/diffdock)"
     )
+    gr.Markdown("")
     with gr.Box():
         with gr.Row():
             with gr.Column():
                     label="SMILES string",
                 )
                 ligand_file = gr.File(file_count="single", label="Input Ligand")
+        n_it = gr.Slider(
+            minimum=10, maximum=40, label="Number of inference steps", step=1
+        )
     btn = gr.Button("Run predictions")
     filenames = gr.Variable()
     out = gr.Dropdown(interactive=True, label="Ranked samples")
     mol = gr.HTML()
+    output_file = gr.File(file_count="single", label="Output files")
     gr.Examples(
         [
             [
+                "6w70",
+                "examples/6w70.pdb",
+                "COc1ccc(cc1)n2c3c(c(n2)C(=O)N)CCN(C3=O)c4ccc(cc4)N5CCCCC5=O",
+                "examples/6w70_ligand.sdf",
+                10,
+            ],
+            [
+                "",
+                "examples/6o5u_protein_processed.pdb",
+                "",
+                "examples/6o5u_ligand.sdf",
+                10,
+            ],
+            [
+                "",
+                "examples/6o5u_protein_processed.pdb",
+                "[NH3+]C[C@H]1O[C@H](O[C@@H]2[C@@H]([NH3+])C[C@H]([C@@H]([C@H]2O)O[C@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)[NH3+])O)[NH3+])[C@@H]([C@H]([C@@H]1O)O)O",
+                "examples/6o5u_ligand.sdf",
+                10,
+            ],
+            [
+                "",
+                "examples/6o5u_protein_processed.pdb",
+                "",
+                "examples/6o5u_ligand.sdf",
+                10,
+            ],
+            [
+                "",
+                "examples/6ahs_protein_processed.pdb",
+                "",
+                "examples/6ahs_ligand.sdf",
+                10,
+            ],
         ],
+        [inp, file, ligand_inp, ligand_file, n_it],
+        [mol, out, filenames, pdb, output_file],
+        # fn=update,
         # cache_examples=True,
     )
     btn.click(
         fn=update,
+        inputs=[inp, file, ligand_inp, ligand_file, n_it],
+        outputs=[mol, out, filenames, pdb, output_file],
     )
+    out.change(fn=updateView, inputs=[out, filenames, pdb, ligand_file], outputs=mol)
 demo.launch()

esm/LICENSE ADDED Viewed

	@@ -0,0 +1,21 @@

+MIT License
+Copyright (c) Facebook, Inc. and its affiliates.
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.

esm/scripts/extract.py CHANGED Viewed

@@ -12,7 +12,7 @@ print("using", sys.executable)
 sys.path.insert( 0,"/home/user/.local/lib/python3.8/site-packages")
 sys.path.insert( 0,"/home/user/app/esm/")
 import os
-print(os.environ)
 import torch
 from esm import Alphabet, FastaBatchedDataset, ProteinBertModel, pretrained, MSATransformer

 sys.path.insert( 0,"/home/user/.local/lib/python3.8/site-packages")
 sys.path.insert( 0,"/home/user/app/esm/")
 import os
 import torch
 from esm import Alphabet, FastaBatchedDataset, ProteinBertModel, pretrained, MSATransformer

examples/6ahs_ligand.sdf ADDED Viewed

	@@ -0,0 +1,97 @@

+6ahs_ligand
+  -I-interpret-
+ 44 47  0  0  0  0  0  0  0  0999 V2000
+  -12.3770   21.8080   53.5010 C   0  0  0  0  0
+  -13.7990   19.8830   53.8470 C   0  0  0  0  0
+  -12.7140   27.6870   53.9730 C   0  0  0  0  0
+  -14.5790   28.9380   54.4000 C   0  0  0  0  0
+  -15.0000   26.1900   58.7440 C   0  0  0  0  0
+  -10.5140   22.1070   55.1220 O   0  0  0  0  0
+  -11.1780   22.7720   54.0310 S   0  0  0  0  0
+  -10.2040   22.9400   53.0000 O   0  0  0  0  0
+  -12.7440   20.6930   54.2570 C   0  0  0  0  0
+  -13.0670   22.0720   52.3070 C   0  0  0  0  0
+  -12.6220   23.4480   51.2580 Cl  0  0  0  0  0
+  -14.1300   21.2760   51.9160 C   0  0  0  0  0
+  -14.4890   20.1760   52.6790 C   0  0  0  0  0
+  -11.7830   24.2640   54.5210 N   0  0  0  0  0
+  -11.7700   25.3520   53.7050 C   0  0  0  0  0
+  -12.5570   24.4620   55.6400 C   0  0  0  0  0
+  -12.9850   23.6850   56.7070 C   0  0  0  0  0
+  -13.0050   25.7840   55.5680 C   0  0  0  0  0
+  -13.7490   26.3750   56.5810 C   0  0  0  0  0
+  -14.1450   25.5950   57.6610 C   0  0  0  0  0
+  -13.7760   24.2500   57.7130 C   0  0  0  0  0
+  -12.3430   26.3420   54.5030 C   0  0  0  0  0
+  -14.1740   27.8640   53.8610 N   0  0  0  0  0
+  -12.3600   28.8800   54.9120 C   0  0  0  0  0
+  -13.6180   29.6030   54.9940 N   0  0  0  0  0
+  -16.0210   29.3400   54.4520 C   0  0  0  0  0
+  -14.0838   19.0169   54.4444 H   0  0  0  0  0
+  -12.1648   27.7040   53.0316 H   0  0  0  0  0
+  -14.4736   27.0274   59.2019 H   0  0  0  0  0
+  -15.9379   26.5405   58.3133 H   0  0  0  0  0
+  -15.2065   25.4321   59.4997 H   0  0  0  0  0
+  -12.2019   20.4558   55.1724 H   0  0  0  0  0
+  -14.6845   21.5143   51.0083 H   0  0  0  0  0
+  -15.3149   19.5397   52.3611 H   0  0  0  0  0
+  -11.4030   25.4307   52.6817 H   0  0  0  0  0
+  -12.7045   22.6331   56.7614 H   0  0  0  0  0
+  -14.0172   27.4303   56.5300 H   0  0  0  0  0
+  -14.1081   23.6324   58.5475 H   0  0  0  0  0
+  -11.5409   29.4916   54.5336 H   0  0  0  0  0
+  -11.9880   28.5603   55.8854 H   0  0  0  0  0
+  -13.7372   30.5065   55.4522 H   0  0  0  0  0
+  -16.4083   29.4311   53.4372 H   0  0  0  0  0
+  -16.5888   28.5825   54.9924 H   0  0  0  0  0
+  -16.1116   30.2979   54.9641 H   0  0  0  0  0
+  7  1  1  0  0  0
+  1  9  4  0  0  0
+  1 10  4  0  0  0
+  9  2  4  0  0  0
+  2 13  4  0  0  0
+ 22  3  1  0  0  0
+  3 23  1  0  0  0
+  3 24  1  0  0  0
+ 23  4  2  0  0  0
+  4 25  1  0  0  0
+  4 26  1  0  0  0
+ 20  5  1  0  0  0
+  7  6  2  0  0  0
+  7  8  2  0  0  0
+ 14  7  1  0  0  0
+ 10 11  1  0  0  0
+ 10 12  4  0  0  0
+ 12 13  4  0  0  0
+ 15 14  4  0  0  0
+ 16 14  4  0  0  0
+ 22 15  4  0  0  0
+ 16 17  4  0  0  0
+ 18 16  4  0  0  0
+ 17 21  4  0  0  0
+ 19 18  4  0  0  0
+ 18 22  4  0  0  0
+ 19 20  4  0  0  0
+ 20 21  4  0  0  0
+ 24 25  1  0  0  0
+  2 27  1  0  0  0
+  3 28  1  0  0  0
+  5 29  1  0  0  0
+  5 30  1  0  0  0
+  5 31  1  0  0  0
+  9 32  1  0  0  0
+ 12 33  1  0  0  0
+ 13 34  1  0  0  0
+ 15 35  1  0  0  0
+ 17 36  1  0  0  0
+ 19 37  1  0  0  0
+ 21 38  1  0  0  0
+ 24 39  1  0  0  0
+ 24 40  1  0  0  0
+ 25 41  1  0  0  0
+ 26 42  1  0  0  0
+ 26 43  1  0  0  0
+ 26 44  1  0  0  0
+M  END
+$$$$

examples/6ahs_protein_processed.pdb ADDED Viewed

The diff for this file is too large to render. See raw diff

examples/6o5u_ligand.sdf ADDED Viewed

	@@ -0,0 +1,154 @@

+6o5u_ligand
+  -I-interpret-
+ 73 75  0  0  0  0  0  0  0  0999 V2000
+  108.6730  -18.4700   -7.8360 C   0  0  0  0  0
+  107.3110  -18.9740   -7.3680 C   0  0  0  0  0
+  107.4800  -20.3570   -6.7640 C   0  0  0  0  0
+  108.0820  -21.2810   -7.8150 C   0  0  0  0  0
+  109.3440  -20.6380   -8.3930 C   0  0  0  0  0
+  109.7960  -21.4700   -9.5890 C   0  0  0  0  0
+  112.5990  -15.8100   -5.7750 C   0  0  0  0  0
+  112.1040  -15.6660   -7.2080 C   0  0  0  0  0
+  110.7540  -16.3630   -7.2880 C   0  0  0  0  0
+  110.8240  -17.8460   -6.8990 C   0  0  0  0  0
+  111.5110  -18.0160   -5.5370 C   0  0  0  0  0
+  112.8430  -17.2770   -5.4680 C   0  0  0  0  0
+  112.8110  -13.7240   -8.4160 C   0  0  0  0  0
+  112.9750  -12.2640   -8.0080 C   0  0  0  0  0
+  111.6610  -11.5000   -8.1330 C   0  0  0  0  0
+  111.2120  -11.6530   -9.5690 C   0  0  0  0  0
+  111.1210  -13.1180   -9.9350 C   0  0  0  0  0
+  110.8030  -13.1430  -11.4220 C   0  0  0  0  0
+  110.9760  -20.8510  -10.1750 N   0  3  0  0  0
+  111.7470  -19.4450   -5.3220 N   0  3  0  0  0
+  113.8400  -15.0670   -5.6100 N   0  3  0  0  0
+  111.8410  -10.0810   -7.8770 N   0  3  0  0  0
+  109.1180  -19.3280   -8.8520 O   0  0  0  0  0
+  106.8170  -18.1010   -6.3680 O   0  0  0  0  0
+  106.1940  -20.8240   -6.3760 O   0  0  0  0  0
+  108.4250  -22.5370   -7.2480 O   0  0  0  0  0
+  109.5510  -18.4650   -6.7100 O   0  0  0  0  0
+  110.3630  -16.2700   -8.6430 O   0  0  0  0  0
+  111.9040  -14.2970   -7.4880 O   0  0  0  0  0
+  112.3420  -13.8090   -9.7580 O   0  0  0  0  0
+  113.3340  -12.2190   -6.6510 O   0  0  0  0  0
+  109.9130  -11.0980   -9.7100 O   0  0  0  0  0
+  110.7860  -14.4810  -11.8020 O   0  0  0  0  0
+  108.6303  -17.4570   -8.2362 H   0  0  0  0  0
+  106.6193  -19.0120   -8.2095 H   0  0  0  0  0
+  108.1401  -20.3313   -5.8970 H   0  0  0  0  0
+  107.3417  -21.4380   -8.5994 H   0  0  0  0  0
+  110.0905  -20.6009   -7.5997 H   0  0  0  0  0
+  108.9974  -21.5151  -10.3294 H   0  0  0  0  0
+  110.0340  -22.4829   -9.2644 H   0  0  0  0  0
+  111.8471  -15.4154   -5.0916 H   0  0  0  0  0
+  112.8209  -16.0908   -7.9107 H   0  0  0  0  0
+  110.0567  -15.8930   -6.5945 H   0  0  0  0  0
+  111.3562  -18.3049   -7.7322 H   0  0  0  0  0
+  110.8622  -17.5955   -4.7687 H   0  0  0  0  0
+  113.2743  -17.3813   -4.4724 H   0  0  0  0  0
+  113.5390  -17.6975   -6.1939 H   0  0  0  0  0
+  113.7563  -14.2662   -8.3935 H   0  0  0  0  0
+  113.7270  -11.8166   -8.6580 H   0  0  0  0  0
+  110.9429  -11.8905   -7.4119 H   0  0  0  0  0
+  111.9311  -11.1480  -10.2139 H   0  0  0  0  0
+  110.3778  -13.5999   -9.2998 H   0  0  0  0  0
+  111.5492  -12.5865  -11.9892 H   0  0  0  0  0
+  109.8423  -12.6689  -11.6228 H   0  0  0  0  0
+  111.2850  -21.4016  -10.9761 H   0  0  0  0  0
+  110.7465  -19.9049  -10.4794 H   0  0  0  0  0
+  111.7205  -20.8142   -9.4787 H   0  0  0  0  0
+  112.2040  -19.5810   -4.4203 H   0  0  0  0  0
+  110.8556  -19.9407   -5.3310 H   0  0  0  0  0
+  112.3452  -19.8052   -6.0655 H   0  0  0  0  0
+  114.1687  -15.1655   -4.6495 H   0  0  0  0  0
+  114.5431  -15.4352   -6.2507 H   0  0  0  0  0
+  113.6746  -14.0815   -5.8147 H   0  0  0  0  0
+  110.9443   -9.6037   -7.9692 H   0  0  0  0  0
+  112.2015   -9.9503   -6.9318 H   0  0  0  0  0
+  112.5031   -9.6965   -8.5509 H   0  0  0  0  0
+  106.7059  -17.2223   -6.7383 H   0  0  0  0  0
+  105.8266  -20.2335   -5.7143 H   0  0  0  0  0
+  107.6379  -22.9476   -6.8827 H   0  0  0  0  0
+  109.5104  -16.6957   -8.7588 H   0  0  0  0  0
+  113.4409  -11.3044   -6.3796 H   0  0  0  0  0
+  109.6229  -11.1925  -10.6202 H   0  0  0  0  0
+  110.5878  -14.5438  -12.7392 H   0  0  0  0  0
+  1  2  1  0  0  0
+  1 23  1  0  0  0
+ 27  1  1  0  0  0
+  2  3  1  0  0  0
+  2 24  1  0  0  0
+  3  4  1  0  0  0
+  3 25  1  0  0  0
+  5  4  1  0  0  0
+  4 26  1  0  0  0
+  5  6  1  0  0  0
+ 23  5  1  0  0  0
+  6 19  1  0  0  0
+  8  7  1  0  0  0
+  7 12  1  0  0  0
+  7 21  1  0  0  0
+  8  9  1  0  0  0
+ 29  8  1  0  0  0
+  9 10  1  0  0  0
+  9 28  1  0  0  0
+ 10 11  1  0  0  0
+ 10 27  1  0  0  0
+ 12 11  1  0  0  0
+ 11 20  1  0  0  0
+ 13 14  1  0  0  0
+ 13 29  1  0  0  0
+ 13 30  1  0  0  0
+ 14 15  1  0  0  0
+ 14 31  1  0  0  0
+ 15 16  1  0  0  0
+ 15 22  1  0  0  0
+ 16 17  1  0  0  0
+ 16 32  1  0  0  0
+ 17 18  1  0  0  0
+ 17 30  1  0  0  0
+ 18 33  1  0  0  0
+  1 34  1  0  0  0
+  2 35  1  0  0  0
+  3 36  1  0  0  0
+  4 37  1  0  0  0
+  5 38  1  0  0  0
+  6 39  1  0  0  0
+  6 40  1  0  0  0
+  7 41  1  0  0  0
+  8 42  1  0  0  0
+  9 43  1  0  0  0
+ 10 44  1  0  0  0
+ 11 45  1  0  0  0
+ 12 46  1  0  0  0
+ 12 47  1  0  0  0
+ 13 48  1  0  0  0
+ 14 49  1  0  0  0
+ 15 50  1  0  0  0
+ 16 51  1  0  0  0
+ 17 52  1  0  0  0
+ 18 53  1  0  0  0
+ 18 54  1  0  0  0
+ 19 55  1  0  0  0
+ 19 56  1  0  0  0
+ 19 57  1  0  0  0
+ 20 58  1  0  0  0
+ 20 59  1  0  0  0
+ 20 60  1  0  0  0
+ 21 61  1  0  0  0
+ 21 62  1  0  0  0
+ 21 63  1  0  0  0
+ 22 64  1  0  0  0
+ 22 65  1  0  0  0
+ 22 66  1  0  0  0
+ 24 67  1  0  0  0
+ 25 68  1  0  0  0
+ 26 69  1  0  0  0
+ 28 70  1  0  0  0
+ 31 71  1  0  0  0
+ 32 72  1  0  0  0
+ 33 73  1  0  0  0
+M  END
+$$$$

examples/6o5u_protein_processed.pdb ADDED Viewed

The diff for this file is too large to render. See raw diff

examples/6w70.pdb ADDED Viewed

The diff for this file is too large to render. See raw diff

examples/6w70_ligand.sdf ADDED Viewed

	@@ -0,0 +1,170 @@

+GG2
+  ModelServer 0.9.9
+ 59 63  0  0  0  0  0  0  0  0  0
+    8.5320    2.5640    9.2510 C   0  0  0  0  0  0  0  0  0  0  0  0
+    9.4650    2.7080   10.2660 C   0  0  0  0  0  0  0  0  0  0  0  0
+    9.8540    3.9770   10.6370 C   0  0  0  0  0  0  0  0  0  0  0  0
+    8.0890    1.3510    8.8580 O   0  0  0  0  0  0  0  0  0  0  0  0
+    9.5960    6.6430   11.6760 N   0  0  0  0  0  0  0  0  0  0  0  0
+    9.8460    9.2980    6.4400 C   0  0  0  0  0  0  0  0  0  0  0  0
+   10.0780    7.7570    8.2120 C   0  0  0  0  0  0  0  0  0  0  0  0
+    9.7660    7.9380   11.8540 C   0  0  0  0  0  0  0  0  0  0  0  0
+    9.7240    8.5870   13.2020 C   0  0  0  0  0  0  0  0  0  0  0  0
+   10.0020    8.5590   10.5660 C   0  0  0  0  0  0  0  0  0  0  0  0
+    9.8890    7.4660    9.6420 C   0  0  0  0  0  0  0  0  0  0  0  0
+   10.7960    9.3120    4.2300 C   0  0  0  0  0  0  0  0  0  0  0  0
+    8.7040    0.2040    9.4320 C   0  0  0  0  0  0  0  0  0  0  0  0
+    9.6840    9.8710    3.7090 C   0  0  0  0  0  0  0  0  0  0  0  0
+    8.7430    9.5470    1.6160 C   0  0  0  0  0  0  0  0  0  0  0  0
+   10.5460   11.1730    1.8740 C   0  0  0  0  0  0  0  0  0  0  0  0
+   10.3530   11.5920    0.4200 C   0  0  0  0  0  0  0  0  0  0  0  0
+    8.7550    9.8660    5.9000 C   0  0  0  0  0  0  0  0  0  0  0  0
+    9.4480   10.0660    8.7730 C   0  0  0  0  0  0  0  0  0  0  0  0
+    9.4050    5.1120    9.9700 C   0  0  0  0  0  0  0  0  0  0  0  0
+    8.4880    4.8930    8.9450 C   0  0  0  0  0  0  0  0  0  0  0  0
+    8.0710    3.6360    8.5650 C   0  0  0  0  0  0  0  0  0  0  0  0
+    9.7130    6.3620   10.3560 N   0  0  0  0  0  0  0  0  0  0  0  0
+    9.8530    9.0000    7.8320 N   0  0  0  0  0  0  0  0  0  0  0  0
+   10.8940    9.0320    5.6080 C   0  0  0  0  0  0  0  0  0  0  0  0
+    9.6180   10.1750    2.3580 N   0  0  0  0  0  0  0  0  0  0  0  0
+    8.6640   10.1500    4.5380 C   0  0  0  0  0  0  0  0  0  0  0  0
+   10.3590    6.8700    7.5200 O   0  0  0  0  0  0  0  0  0  0  0  0
+   10.1420   10.3580   -0.4200 C   0  0  0  0  0  0  0  0  0  0  0  0
+    7.9090    8.8200    2.0390 O   0  0  0  0  0  0  0  0  0  0  0  0
+    8.8940    9.7380    0.1160 C   0  0  0  0  0  0  0  0  0  0  0  0
+   10.1430    9.7080   13.3960 O   0  0  0  0  0  0  0  0  0  0  0  0
+    9.3030    7.8290   14.1650 N   0  0  0  0  0  0  0  0  0  0  0  0
+   10.2120    9.9570   10.1020 C   0  0  0  0  0  0  0  0  0  0  0  0
+    9.8220    1.9610   10.6890 H   0  0  0  0  0  0  0  0  0  0  0  0
+   10.4350    4.0780   11.3560 H   0  0  0  0  0  0  0  0  0  0  0  0
+   11.5100    9.1080    3.6700 H   0  0  0  0  0  0  0  0  0  0  0  0
+    9.6620    0.2420    9.2830 H   0  0  0  0  0  0  0  0  0  0  0  0
+    8.3440   -0.5970    9.0190 H   0  0  0  0  0  0  0  0  0  0  0  0
+    8.5260    0.1840   10.3850 H   0  0  0  0  0  0  0  0  0  0  0  0
+   11.4450   10.8220    1.9700 H   0  0  0  0  0  0  0  0  0  0  0  0
+   10.4580   11.9630    2.4300 H   0  0  0  0  0  0  0  0  0  0  0  0
+    9.5760   12.1690    0.3490 H   0  0  0  0  0  0  0  0  0  0  0  0
+   11.1420   12.0630    0.1110 H   0  0  0  0  0  0  0  0  0  0  0  0
+    8.0370   10.0770    6.4520 H   0  0  0  0  0  0  0  0  0  0  0  0
+    9.6710   10.9200    8.3700 H   0  0  0  0  0  0  0  0  0  0  0  0
+    8.5030    9.9540    8.9620 H   0  0  0  0  0  0  0  0  0  0  0  0
+    8.1410    5.6300    8.4960 H   0  0  0  0  0  0  0  0  0  0  0  0
+    7.4850    3.5260    7.8520 H   0  0  0  0  0  0  0  0  0  0  0  0
+   11.6760    8.6640    5.9510 H   0  0  0  0  0  0  0  0  0  0  0  0
+    7.8890   10.5370    4.2000 H   0  0  0  0  0  0  0  0  0  0  0  0
+   10.8920    9.7500   -0.3240 H   0  0  0  0  0  0  0  0  0  0  0  0
+   10.0280   10.5980   -1.3530 H   0  0  0  0  0  0  0  0  0  0  0  0
+    8.8120    8.8620   -0.2930 H   0  0  0  0  0  0  0  0  0  0  0  0
+    8.1520   10.2900   -0.1770 H   0  0  0  0  0  0  0  0  0  0  0  0
+    9.2620    8.1830   15.1100 H   0  0  0  0  0  0  0  0  0  0  0  0
+    8.9950    6.8970   13.9610 H   0  0  0  0  0  0  0  0  0  0  0  0
+   11.1570   10.1290    9.9640 H   0  0  0  0  0  0  0  0  0  0  0  0
+    9.8550   10.5850   10.7490 H   0  0  0  0  0  0  0  0  0  0  0  0
+  1  2  1  0  0  0  0
+  1  4  1  0  0  0  0
+  1 22  2  0  0  0  0
+  2  3  2  0  0  0  0
+  2 35  1  0  0  0  0
+  3 20  1  0  0  0  0
+  3 36  1  0  0  0  0
+  4 13  1  0  0  0  0
+  5 23  1  0  0  0  0
+  5  8  2  0  0  0  0
+  6 25  2  0  0  0  0
+  6 18  1  0  0  0  0
+  6 24  1  0  0  0  0
+  7 24  1  0  0  0  0
+  7 28  2  0  0  0  0
+  7 11  1  0  0  0  0
+  8 10  1  0  0  0  0
+  8  9  1  0  0  0  0
+  9 32  2  0  0  0  0
+  9 33  1  0  0  0  0
+ 10 34  1  0  0  0  0
+ 10 11  2  0  0  0  0
+ 11 23  1  0  0  0  0
+ 12 14  2  0  0  0  0
+ 12 25  1  0  0  0  0
+ 12 37  1  0  0  0  0
+ 13 38  1  0  0  0  0
+ 13 39  1  0  0  0  0
+ 13 40  1  0  0  0  0
+ 14 26  1  0  0  0  0
+ 14 27  1  0  0  0  0
+ 15 31  1  0  0  0  0
+ 15 30  2  0  0  0  0
+ 15 26  1  0  0  0  0
+ 16 17  1  0  0  0  0
+ 16 26  1  0  0  0  0
+ 16 41  1  0  0  0  0
+ 16 42  1  0  0  0  0
+ 17 29  1  0  0  0  0
+ 17 43  1  0  0  0  0
+ 17 44  1  0  0  0  0
+ 18 27  2  0  0  0  0
+ 18 45  1  0  0  0  0
+ 19 24  1  0  0  0  0
+ 19 34  1  0  0  0  0
+ 19 46  1  0  0  0  0
+ 19 47  1  0  0  0  0
+ 20 23  1  0  0  0  0
+ 20 21  2  0  0  0  0
+ 21 22  1  0  0  0  0
+ 21 48  1  0  0  0  0
+ 22 49  1  0  0  0  0
+ 25 50  1  0  0  0  0
+ 27 51  1  0  0  0  0
+ 29 31  1  0  0  0  0
+ 29 52  1  0  0  0  0
+ 29 53  1  0  0  0  0
+ 31 54  1  0  0  0  0
+ 31 55  1  0  0  0  0
+ 33 56  1  0  0  0  0
+ 33 57  1  0  0  0  0
+ 34 58  1  0  0  0  0
+ 34 59  1  0  0  0  0
+M  END
+> <model_server_result.job_id>
+jhYbiAhZngEaKGexZ2WIZQ
+> <model_server_result.datetime_utc>
+2022-10-10 01:28:25
+> <model_server_result.server_version>
+0.9.9
+> <model_server_result.query_name>
+ligand
+> <model_server_result.source_id>
+pdb-bcif
+> <model_server_result.entry_id>
+6w70
+> <model_server_params.name>
+atom_site
+> <model_server_params.value>
+{"label_asym_id":"E","auth_seq_id":303}
+> <model_server_stats.io_time_ms>
+49
+> <model_server_stats.parse_time_ms>
+60
+> <model_server_stats.create_model_time_ms>
+10
+> <model_server_stats.query_time_ms>
+220
+> <model_server_stats.encode_time_ms>
+0
+> <model_server_stats.element_count>
+59
+$$$$