conversations
stringlengths 109
9.01k
|
|---|
[{"from": "human", "value": "Write water solubility of given SELFIES in 25 \u00b0C. -> [C][C][=N][C][=C][N][=C][C][=N][C][Ring1][=Branch1][=N][Ring1][#Branch2]\n"}, {"from": "gpt", "value": " 0.7585775750291838 mol/L\n"}] |
[{"from": "human", "value": "Given InChI, write its water solubility expressed as a logarithm in mol/L in 25 \u00b0C. -> InChI=1S/C10H7I/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H\n"}, {"from": "gpt", "value": " -4.55\n"}] |
[{"from": "human", "value": "What is compound of given SMILES? -> CCCO\n"}, {"from": "gpt", "value": " 1-Propanol\n"}] |
[{"from": "human", "value": "Write InChI of given compound. -> 3-Methyl-3-pentanol\n"}, {"from": "gpt", "value": " InChI=1S/C6H14O/c1-4-6(3,7)5-2/h7H,4-5H2,1-3H3\n"}] |
[{"from": "human", "value": "Given SMILES, write its compound. -> Fc1cccc(F)c1C(=O)NC(=O)Nc2ccc(Cl)cc2\n"}, {"from": "gpt", "value": " difluron\n"}] |
[{"from": "human", "value": "What is compound of given SMILES? -> Oc1c(Cl)cccc1Cl\n"}, {"from": "gpt", "value": " 2,6-Dichlorophenol\n"}] |
[{"from": "human", "value": "Write aqueous solubility of given SMILES in room temperature. -> C1SC(=S)NC1(=O)\n"}, {"from": "gpt", "value": " 0.016982436524617443 mol/L\n"}] |
[{"from": "human", "value": "Given SELFIES, write its aqueous solubility in 25 \u00b0C. -> [Cl][C][=C][C][=C][C][=C][Ring1][=Branch1][Cl]\n"}, {"from": "gpt", "value": " 0.0008912509381337459 mol/L\n"}] |
[{"from": "human", "value": "Given InChI, write its water solubility in room temperature. -> InChI=1S/C12H14ClNO2/c1-12(2)8-16-14(11(12)15)7-9-5-3-4-6-10(9)13/h3-6H,7-8H2,1-2H3\n"}, {"from": "gpt", "value": " 0.004591980128368685 mol/L\n"}] |
[{"from": "human", "value": "Given SELFIES, write its compound. -> [C][Br]\n"}, {"from": "gpt", "value": " Bromomethane\n"}] |
[{"from": "human", "value": "Write water solubility expressed as a logarithm in mol/L of given SELFIES in 25 \u00b0C. -> [Br][C][=C][C][=C][C][=C][C][=C][C][=C][Ring1][#Branch2][Ring1][=Branch1]\n"}, {"from": "gpt", "value": " -4.35\n"}] |
[{"from": "human", "value": "What is compound of given SMILES? -> CCOCCOCC\n"}, {"from": "gpt", "value": " 1,2-Diethoxyethane \n"}] |
[{"from": "human", "value": "Given compound, write its potential SMILES. -> Neburon\n"}, {"from": "gpt", "value": " CCCCN(C)C(=O)Nc1ccc(Cl)c(Cl)c1\n"}] |
[{"from": "human", "value": "Given InChI, write its aqueous solubility in 25 \u00b0C. -> InChI=1S/C6H4N2O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H\n"}, {"from": "gpt", "value": " 0.0007943282347242813 mol/L\n"}] |
[{"from": "human", "value": "What is aqueous solubility of given InChI in room temperature? -> InChI=1S/C21H30O4/c1-20-8-7-13(23)9-12(20)3-4-14-15-5-6-16(18(25)11-22)21(15,2)10-17(24)19(14)20/h9,14-17,19,22,24H,3-8,10-11H2,1-2H3\n"}, {"from": "gpt", "value": " 0.0005754399373371566 mol/L\n"}] |
[{"from": "human", "value": "Given compound, write its InChI. -> Carvone\n"}, {"from": "gpt", "value": " InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9H,1,5-6H2,2-3H3\n"}] |
[{"from": "human", "value": "Given compound, write its potential SMILES. -> Chloroacetonitrile\n"}, {"from": "gpt", "value": " ClCC#N\n"}] |
[{"from": "human", "value": "Given SMILES, write its aqueous solubility expressed as a logarithm in mol/L in 25 \u00b0C. -> CCCBr\n"}, {"from": "gpt", "value": " -1.73\n"}] |
[{"from": "human", "value": "Given compound, write its potential SELFIES. -> 1-Nonanol\n"}, {"from": "gpt", "value": " [C][C][C][C][C][C][C][C][C][O]\n"}] |
[{"from": "human", "value": "Write a possible SMILES of given compound. -> 1,4-Dibromobenzene\n"}, {"from": "gpt", "value": " Brc1ccc(Br)cc1\n"}] |
[{"from": "human", "value": "What is water solubility expressed as a logarithm in mol/L of given InChI in 25 \u00b0C? -> InChI=1S/C13H22N2O/c1-15(2)13(16)14-12-7-8-6-11(12)10-5-3-4-9(8)10/h8-12H,3-7H2,1-2H3,(H,14,16)\n"}, {"from": "gpt", "value": " -3.1710000000000003\n"}] |
[{"from": "human", "value": "Given compound, write its potential SELFIES. -> 1,2-Diethoxyethane \n"}, {"from": "gpt", "value": " [C][C][O][C][C][O][C][C]\n"}] |
[{"from": "human", "value": "Given compound, write its water solubility expressed as a logarithm in mol/L in room temperature. -> o-Nitrotoluene\n"}, {"from": "gpt", "value": " -2.33\n"}] |
[{"from": "human", "value": "Write compound of given SELFIES. -> [C][C][C][Branch1][C][C][C][C][O]\n"}, {"from": "gpt", "value": " 3-Methyl-2-pentanol\n"}] |
[{"from": "human", "value": "Write compound of given InChI. -> InChI=1S/C7H16/c1-5-6-7(2,3)4/h5-6H2,1-4H3\n"}, {"from": "gpt", "value": " 2,2-Dimethylpentane\n"}] |
[{"from": "human", "value": "Given compound, write its potential SMILES. -> Methyl hydrazine\n"}, {"from": "gpt", "value": " CNN\n"}] |
[{"from": "human", "value": "Write a possible SMILES of given compound. -> 1-Bromopropane\n"}, {"from": "gpt", "value": " CCCBr\n"}] |
[{"from": "human", "value": "What is compound of given InChI? -> InChI=1S/C6H2Cl4O/c7-2-1-3(11)5(9)6(10)4(2)8/h1,11H\n"}, {"from": "gpt", "value": " 2,3,4,5-Tetrachlorophenol\n"}] |
[{"from": "human", "value": "Given SMILES, write its water solubility in 25 \u00b0C. -> o1c2ccccc2c3ccccc13\n"}, {"from": "gpt", "value": " 2.5118864315095822e-05 mol/L\n"}] |
[{"from": "human", "value": "Given InChI, write its compound. -> InChI=1S/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3\n"}, {"from": "gpt", "value": " Acetophenone\n"}] |
[{"from": "human", "value": "Write compound of given SMILES. -> COP(=S)(OC)Oc1cc(Cl)c(Br)cc1Cl\n"}, {"from": "gpt", "value": " Bromophos\n"}] |
[{"from": "human", "value": "Write water solubility of given compound in room temperature. -> Ethyne\n"}, {"from": "gpt", "value": " 1.9498445997580451 mol/L\n"}] |
[{"from": "human", "value": "Given InChI, write its compound. -> InChI=1S/C6H12O/c1-5(7)6(2,3)4/h1-4H3\n"}, {"from": "gpt", "value": " 3,3-Dimethyl-2-butanone\n"}] |
[{"from": "human", "value": "What is compound of given SELFIES? -> [C][C][C][C][C][C][C][C][C]\n"}, {"from": "gpt", "value": " Nonane\n"}] |
[{"from": "human", "value": "Write compound of given SMILES. -> Clc1cccc(Br)c1\n"}, {"from": "gpt", "value": " m-Chlorobromobenzene\n"}] |
[{"from": "human", "value": "What is aqueous solubility of given SMILES in 25 \u00b0C? -> Cc1ccc(C)c2ccccc12\n"}, {"from": "gpt", "value": " 7.244359600749906e-05 mol/L\n"}] |
[{"from": "human", "value": "Write compound of given InChI. -> InChI=1S/C7H14O2/c1-3-5-6-7(8)9-4-2/h3-6H2,1-2H3\n"}, {"from": "gpt", "value": " Pentyl propanoate\n"}] |
[{"from": "human", "value": "What is water solubility expressed as a logarithm in mol/L of given InChI in 25 \u00b0C? -> InChI=1S/C10H14/c1-9(2)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3\n"}, {"from": "gpt", "value": " -4.12\n"}] |
[{"from": "human", "value": "What is water solubility expressed as a logarithm in mol/L of given compound in 25 \u00b0C? -> 3-Ethyl-3-pentanol\n"}, {"from": "gpt", "value": " -0.85\n"}] |
[{"from": "human", "value": "Given SELFIES, write its water solubility expressed as a logarithm in mol/L in 25 \u00b0C. -> [C][=C][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][C][Ring1][#Branch2][=C][Ring1][=C]\n"}, {"from": "gpt", "value": " -6.35\n"}] |
[{"from": "human", "value": "Write compound of given SELFIES. -> [C][O][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1]\n"}, {"from": "gpt", "value": " Methyl benzoate \n"}] |
[{"from": "human", "value": "Write InChI of given compound. -> Benzo(a)fluorene\n"}, {"from": "gpt", "value": " InChI=1S/C17H12/c1-3-7-14-12(5-1)9-10-16-15-8-4-2-6-13(15)11-17(14)16/h1-10H,11H2\n"}] |
[{"from": "human", "value": "Write aqueous solubility expressed as a logarithm in mol/L of given compound in 25 \u00b0C. -> 2-butenal\n"}, {"from": "gpt", "value": " 0.32\n"}] |
[{"from": "human", "value": "Given InChI, write its water solubility expressed as a logarithm in mol/L in room temperature. -> InChI=1S/C8H8O2/c1-10-8-4-2-7(6-9)3-5-8/h2-6H,1H3\n"}, {"from": "gpt", "value": " -1.49\n"}] |
[{"from": "human", "value": "Given compound, write its potential SELFIES. -> 1,1,2-Trichlorotrifluoroethane\n"}, {"from": "gpt", "value": " [F][C][Branch1][C][F][Branch1][C][Cl][C][Branch1][C][F][Branch1][C][Cl][Cl]\n"}] |
[{"from": "human", "value": "What is InChI of given compound? -> Dicofol\n"}, {"from": "gpt", "value": " InChI=1S/C14H9Cl5O/c15-11-5-1-9(2-6-11)13(20,14(17,18)19)10-3-7-12(16)8-4-10/h1-8,20H\n"}] |
[{"from": "human", "value": "What is InChI of given compound? -> Thiometon\n"}, {"from": "gpt", "value": " InChI=1S/C6H15O2PS3/c1-4-11-5-6-12-9(10,7-2)8-3/h4-6H2,1-3H3\n"}] |
[{"from": "human", "value": "Given InChI, write its aqueous solubility expressed as a logarithm in mol/L in room temperature. -> InChI=1S/C22H27NO2/c1-4-22(24)10-8-18-16-6-5-15-11-19-14(13-23-25-19)12-20(15,2)17(16)7-9-21(18,22)3/h1,11,13,16-18,24H,5-10,12H2,2-3H3\n"}, {"from": "gpt", "value": " -5.507000000000001\n"}] |
[{"from": "human", "value": "Given SELFIES, write its water solubility expressed as a logarithm in mol/L in room temperature. -> [C][C][C][C][C][C][Branch1][C][C][C]\n"}, {"from": "gpt", "value": " -5.08\n"}] |
[{"from": "human", "value": "Write aqueous solubility expressed as a logarithm in mol/L of given compound in room temperature. -> Flumethasone\n"}, {"from": "gpt", "value": " -5.6129999999999995\n"}] |
[{"from": "human", "value": "Write a possible SMILES of given compound. -> o-Chloroaniline\n"}, {"from": "gpt", "value": " Nc1ccccc1Cl\n"}] |
[{"from": "human", "value": "What is compound of given InChI? -> InChI=1S/C22H24N2O4/c1-2-3-6-15-19(25)28-16-24-20(26)22(23-21(24)27,17-11-7-4-8-12-17)18-13-9-5-10-14-18/h4-5,7-14H,2-3,6,15-16H2,1H3,(H,23,27)\n"}, {"from": "gpt", "value": " 3-Hexanoyloxymethylphenyltoin\n"}] |
[{"from": "human", "value": "What is aqueous solubility of given InChI in 25 \u00b0C? -> InChI=1S/C8H14N4OS/c1-8(2,3)5-6(13)12(9)7(14-4)11-10-5/h9H2,1-4H3\n"}, {"from": "gpt", "value": " 0.005584701947368306 mol/L\n"}] |
[{"from": "human", "value": "Given InChI, write its aqueous solubility expressed as a logarithm in mol/L in room temperature. -> InChI=1S/C12H12N2O3/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16/h3-7H,2H2,1H3,(H2,13,14,15,16,17)\n"}, {"from": "gpt", "value": " -2.322\n"}] |
[{"from": "human", "value": "What is compound of given InChI? -> InChI=1S/C3H3N/c1-2-3-4/h2H,1H2\n"}, {"from": "gpt", "value": " Acrylonitrile\n"}] |
[{"from": "human", "value": "Given compound, write its potential SELFIES. -> glucose\n"}, {"from": "gpt", "value": " [O][C][C][O][C][Branch1][C][O][C][Branch1][C][O][C][Branch1][C][O][C][Ring1][=Branch2][O]\n"}] |
[{"from": "human", "value": "Given SMILES, write its aqueous solubility expressed as a logarithm in mol/L in 25 \u00b0C. -> O=C1NC(=O)NC(=O)C1(CC=C)c1ccccc1\n"}, {"from": "gpt", "value": " -2.369\n"}] |
[{"from": "human", "value": "What is water solubility expressed as a logarithm in mol/L of given compound in 25 \u00b0C? -> phthalamide\n"}, {"from": "gpt", "value": " -2.932\n"}] |
[{"from": "human", "value": "What is aqueous solubility expressed as a logarithm in mol/L of given compound in room temperature? -> 2-Undecanol\n"}, {"from": "gpt", "value": " -2.94\n"}] |
[{"from": "human", "value": "Write a possible SELFIES of given compound. -> Quinethazone\n"}, {"from": "gpt", "value": " [C][C][C][N][C][=Branch1][C][=O][C][=C][C][=Branch1][N][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][N][Ring1][N][S][Branch1][C][N][=Branch1][C][=O][=O]\n"}] |
[{"from": "human", "value": "Write compound of given InChI. -> InChI=1S/C7H14/c1-3-5-7-6-4-2/h3H,1,4-7H2,2H3\n"}, {"from": "gpt", "value": " 1-Heptene\n"}] |
[{"from": "human", "value": "Write water solubility expressed as a logarithm in mol/L of given SMILES in 25 \u00b0C. -> Cc1ccccc1n3c(C)nc2ccccc2c3=O\n"}, {"from": "gpt", "value": " -2.925\n"}] |
[{"from": "human", "value": "What is aqueous solubility expressed as a logarithm in mol/L of given compound in 25 \u00b0C? -> Quintozene\n"}, {"from": "gpt", "value": " -5.82\n"}] |
[{"from": "human", "value": "Write solubility expressed as a logarithm in mol/L of given SELFIES in 25 \u00b0C. -> [C][=C][C][=C][N][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][C][Ring1][#Branch2][=C][Ring1][=C]\n"}, {"from": "gpt", "value": " Unable to answer the question due to lack of conditions\n"}] |
[{"from": "human", "value": "Write aqueous solubility of given compound in 25 \u00b0C. -> 2-Ethyltoluene\n"}, {"from": "gpt", "value": " 0.0006165950018614823 mol/L\n"}] |
[{"from": "human", "value": "Write oil solubility expressed as a logarithm in mol/L of given SMILES in 25 \u00b0C. -> Cc1cc(ccc1NS(=O)(=O)C(F)(F)F)S(=O)(=O)c2ccccc2\n"}, {"from": "gpt", "value": " Unable to answer the question due to lack of conditions\n"}] |
[{"from": "human", "value": "What will be SELFIES of given compound? -> Isobutyl acetate\n"}, {"from": "gpt", "value": " [C][C][Branch1][C][C][C][O][C][=Branch1][C][=O][C]\n"}] |
[{"from": "human", "value": "Write water solubility of given SELFIES in room temperature. -> [Cl][C][=C][C][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Ring1][Branch2]\n"}, {"from": "gpt", "value": " 0.0002570395782768865 mol/L\n"}] |
[{"from": "human", "value": "Write water solubility expressed as a logarithm in mol/L of given SELFIES in room temperature. -> [C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][P][Ring1][#Branch2]\n"}, {"from": "gpt", "value": " -6.68\n"}] |
[{"from": "human", "value": "What is compound of given InChI? -> InChI=1S/C8H16/c1-3-5-7-8-6-4-2/h3H,1,4-8H2,2H3\n"}, {"from": "gpt", "value": " 1-Octene \n"}] |
[{"from": "human", "value": "What is compound of given SELFIES? -> [C][=C][C][=C][C][=C][Ring1][=Branch1][O]\n"}, {"from": "gpt", "value": " Phenol\n"}] |
[{"from": "human", "value": "What is water solubility of given compound in room temperature? -> P,P'-DDE\n"}, {"from": "gpt", "value": " 1.2589254117941662e-07 mol/L\n"}] |
[{"from": "human", "value": "Write a possible SMILES of given compound. -> salicylanilide\n"}, {"from": "gpt", "value": " c1ccccc1NC(=O)c2c(O)cccc2\n"}] |
[{"from": "human", "value": "Given compound, write its InChI. -> 1,1,2-Trichloroethane\n"}, {"from": "gpt", "value": " InChI=1S/C2H3Cl3/c3-1-2(4)5/h2H,1H2\n"}] |
[{"from": "human", "value": "Given compound, write its potential SMILES. -> Fluoromethalone\n"}, {"from": "gpt", "value": " CC1CC2C3CCC(O)(C(=O)C)C3(C)CC(O)C2(F)C4(C)C=CC(=O)C=C14\n"}] |
[{"from": "human", "value": "Given SELFIES, write its aqueous solubility expressed as a logarithm in mol/L in 25 \u00b0C. -> [C][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1]\n"}, {"from": "gpt", "value": " -1.28\n"}] |
[{"from": "human", "value": "Given SELFIES, write its aqueous solubility expressed as a logarithm in mol/L in 25 \u00b0C. -> [N][C][=C][C][=C][C][=C][Ring1][=Branch1][O]\n"}, {"from": "gpt", "value": " -0.72\n"}] |
[{"from": "human", "value": "Given SMILES, write its water solubility in 25 \u00b0C. -> CCCCCCC(=O)OCC\n"}, {"from": "gpt", "value": " 0.0018197008586099826 mol/L\n"}] |
[{"from": "human", "value": "Given InChI, write its compound. -> InChI=1S/C20H16/c1-13-16-8-5-6-9-17(16)14(2)20-18(13)12-11-15-7-3-4-10-19(15)20/h3-12H,1-2H3\n"}, {"from": "gpt", "value": " 7,12-Dimethylbenz(a)anthracene\n"}] |
[{"from": "human", "value": "Given compound, write its potential SMILES. -> Griseofulvin\n"}, {"from": "gpt", "value": " COC1=CC(=O)CC(C)C13Oc2c(Cl)c(OC)cc(OC)c2C3=O\n"}] |
[{"from": "human", "value": "What is compound of given SELFIES? -> [C][C][C][C][C][C][Branch1][C][C][C]\n"}, {"from": "gpt", "value": " 2-Methylheptane\n"}] |
[{"from": "human", "value": "What is compound of given SMILES? -> CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n2cncn2\n"}, {"from": "gpt", "value": " Triadimefon\n"}] |
[{"from": "human", "value": "Write a possible SELFIES of given compound. -> Butanethiol \n"}, {"from": "gpt", "value": " [C][C][C][C][S]\n"}] |
[{"from": "human", "value": "Given InChI, write its aqueous solubility in 25 \u00b0C. -> InChI=1S/C7H10N2O3/c1-3-7(2)4(10)8-6(12)9-5(7)11/h3H2,1-2H3,(H2,8,9,10,11,12)\n"}, {"from": "gpt", "value": " 0.0591561634175474 mol/L\n"}] |
[{"from": "human", "value": "Given compound, write its potential SMILES. -> Sulfallate\n"}, {"from": "gpt", "value": " CCN(CC)C(=S)SCC(Cl)=C\n"}] |
[{"from": "human", "value": "Given InChI, write its compound. -> InChI=1S/C19H17ClN2O4/c20-12-5-6-14-17(7-8-21-18(14)9-12)22-16-4-2-1-3-15(16)19(25)26-11-13(24)10-23/h1-9,13,23-24H,10-11H2,(H,21,22)\n"}, {"from": "gpt", "value": " Glafenine\n"}] |
[{"from": "human", "value": "Given compound, write its potential SELFIES. -> Methanol\n"}, {"from": "gpt", "value": " [C][O]\n"}] |
[{"from": "human", "value": "What is compound of given SMILES? -> C/C1CCC(\\C)CC1\n"}, {"from": "gpt", "value": " trans-1,4-Dimethylcyclohexane\n"}] |
[{"from": "human", "value": "Write aqueous solubility expressed as a logarithm in mol/L of given InChI in room temperature. -> InChI=1S/C6H12/c1-2-4-6-5-3-1/h1-6H2\n"}, {"from": "gpt", "value": " -3.1\n"}] |
[{"from": "human", "value": "Write compound of given SMILES. -> CCN(=O)=O\n"}, {"from": "gpt", "value": " Nitroethane\n"}] |
[{"from": "human", "value": "Given compound, write its potential SELFIES. -> Anisole\n"}, {"from": "gpt", "value": " [C][O][C][=C][C][=C][C][=C][Ring1][=Branch1]\n"}] |
[{"from": "human", "value": "What is compound of given InChI? -> InChI=1S/C9H12/c1-3-9-6-4-8(2)5-7-9/h4-7H,3H2,1-2H3\n"}, {"from": "gpt", "value": " 4-Ethyltoluene\n"}] |
[{"from": "human", "value": "Write aqueous solubility of given InChI in room temperature. -> InChI=1S/C13H10Cl2O2/c14-10-1-3-12(16)8(6-10)5-9-7-11(15)2-4-13(9)17/h1-4,6-7,16-17H,5H2\n"}, {"from": "gpt", "value": " 0.00011142945335917292 mol/L\n"}] |
[{"from": "human", "value": "What is compound of given InChI? -> InChI=1S/C17H20N2O/c1-17(2,14-10-6-4-7-11-14)18-16(20)19(3)15-12-8-5-9-13-15/h4-13H,1-3H3,(H,18,20)\n"}, {"from": "gpt", "value": " Methyldymron\n"}] |
[{"from": "human", "value": "Write water solubility expressed as a logarithm in mol/L of given InChI in 25 \u00b0C. -> InChI=1S/C6H4Cl2O/c7-4-1-2-6(9)5(8)3-4/h1-3,9H\n"}, {"from": "gpt", "value": " -1.55\n"}] |
[{"from": "human", "value": "Write a possible SELFIES of given compound. -> 1,2-Diethylbenzene\n"}, {"from": "gpt", "value": " [C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C]\n"}] |
[{"from": "human", "value": "Write aqueous solubility of given SMILES in room temperature. -> O=N(=O)c1cc(Cl)c(Cl)cc1\n"}, {"from": "gpt", "value": " 0.000630957344480193 mol/L\n"}] |
[{"from": "human", "value": "What is InChI of given compound? -> Hexadecane\n"}, {"from": "gpt", "value": " InChI=1S/C16H34/c1-3-5-7-9-11-13-15-16-14-12-10-8-6-4-2/h3-16H2,1-2H3\n"}] |
[{"from": "human", "value": "Write a possible SMILES of given compound. -> 1,2,3-Trichlorobenzene\n"}, {"from": "gpt", "value": " Clc1cccc(Cl)c1Cl\n"}] |
[{"from": "human", "value": "Write aqueous solubility of given compound in 25 \u00b0C. -> Reposal\n"}, {"from": "gpt", "value": " 0.0020137242498623874 mol/L\n"}] |
Subsets and Splits