Datasets:

---

OpenMol

/

MolInst_RS_125K_SMILES_1_32_MMChat

like 0

Follow

OpenMol 6

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): CC(N)C(c1ccc(O)cc1)c1ccc(O)cc1.O=C(Cl)c1ccccc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: CN1CCC(C(=O)Cl)CC1.Nc1ccc(N2C(=O)CC(=O)Nc3c2ccc2ccccc32)cc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "What reactants could lead to the production of the following product? <molecule_2d>", "role": "user" }, { "content": "CCCN=C=O.COc1ccc(CNC(=O)c2cc([N+](=O)[O-])ccc2NC2CCC(N)CC2)cc1OC", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Do retrosynthesis with the product <molecule_2d> .", "role": "user" }, { "content": "OK. The reactants may be O=C(Cn1ccc2ccncc21)OCc1ccccc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "What reactants could lead to the production of the following product? <molecule_2d>", "role": "user" }, { "content": "O=[N+]([O-])c1ccc2oc(N3CCN4CCC3CC4)nc2c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?", "role": "user" }, { "content": "Cn1cc(Br)cc(Nc2ccc(C3CCN(C(=O)OC(C)(C)C)CC3)cn2)c1=O", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "COc1ccc(C(=O)Nc2cc(N)ccc2Cl)cc1OC.O=C(Cl)c1cccc(N2CCOCC2)c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Do retrosynthesis with the product <molecule_2d> .", "role": "user" }, { "content": "OK. The reactants may be Cc1nc(N2CCN(Cc3csc4ccc(Cl)cc34)C2=O)sc1C(=O)O.NCc1cccnc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.", "role": "user" }, { "content": "Here are possible reactants: CC(=O)OCc1nc2sc(S(N)(=O)=O)cc2c(=O)n1-c1ccccc1Cl .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>", "role": "user" }, { "content": "C=O.COc1ccc2c(c1)CC(C(=O)N1CC34CNCC3(COC4)C1)Cn1c-2c(C2CCCCC2)c2ccc(C(=O)NS(=O)(=O)C3CC3)cc21", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>", "role": "user" }, { "content": "C=O.O=S(=O)(c1ccccc1)n1cc(-c2cnn(C3CCNCC3)c2)c2ccc(F)cc21", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.", "role": "user" }, { "content": "CI.O=C(CCc1ccc(Cl)cc1Cl)NC1CC(=O)c2ccccc2NC1=O", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Do retrosynthesis with the product <molecule_2d> .", "role": "user" }, { "content": "OK. The reactants may be O=C(NC(CNCC(Cc1ccccc1)NC(=O)OCc1cncs1)Cc1ccccc1)OCc1cncs1.O=Cc1ccccc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "COC(=O)C(Cc1ccc(NC(=O)c2c(Cl)cccc2Cl)cc1)NC(=O)c1ccc(-n2nnnc2NCc2cccc(O)c2)cc1Cl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "Brc1ccc(N(c2ccccc2)c2cccc3c2sc2ccccc23)cc1.CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: CC(C)(C)OC(=O)c1ccc(-c2ccccc2)cc1NC(=O)c1cc(-c2ncccn2)ccc1O .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>", "role": "user" }, { "content": "COc1ccc(-c2c(-c3ccccc3)nn3ccncc23)cn1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): COc1ccc2c3c(c(=O)oc2c1)CNCC3.ClCCN1CC2CCC1CC2 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "CC(C)C1(C)N=C(c2nc3ccc([N+](=O)[O-])cc3cc2C(=O)O)NC1=O", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>", "role": "user" }, { "content": "COc1cn(-c2cccc(-c3ccccc3)c2)c(-c2ccccc2)cc1=O", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "What reactants could lead to the production of the following product? <molecule_2d>", "role": "user" }, { "content": "Cc1ccc(NC(=O)OCc2ccccc2)cc1Oc1ccc2nc(N)sc2n1.O=C(Cl)C1CC1", "role": "assistant" } ]