Datasets:

---

OpenMol

/

MolInst_RS_125K_SMILES_1_32_MMChat

like 0

Follow

OpenMol 6

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: COC(=O)C(C)(C)Nc1cccc(C2Nc3ccc(C(F)(F)F)cc3CC2(C)C)c1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.", "role": "user" }, { "content": "CC(C)N.CCOC(=O)c1ccc2c(c1)CC(C)(C)C(c1cccc(NC(C)(C)C(=O)O)c1)N2", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>", "role": "user" }, { "content": "CC#CCOc1ccc(CC(NC(=O)C(C=CCCCCCCC(F)(F)CCCCCCC)C(O)(CCC)C(=O)O)C(=O)OC)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>", "role": "user" }, { "content": "CC(C)(C)[Si](C)(C)Cl.OCc1cccc(O)c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?", "role": "user" }, { "content": "CC(C)(C)OC(=O)N(CCN(Cc1ccc(F)cc1)C(=O)OC(C)(C)C)CCN1C(=O)c2ccccc2C1=O", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: CCCCCCCN.O=C(Cl)Cc1ccc(Cl)cc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): COc1ccc(C#N)cc1F .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): CN(C)CCCl.O=Cc1cccc(O)c1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): CC(=O)Cl.COc1ccc(C(=O)O)cc1O .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.", "role": "user" }, { "content": "Here are possible reactants: COc1ccc(Br)c(C)c1.O=C1CCC(=O)N1Br .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>", "role": "user" }, { "content": "C=Cc1cc(CNC(=O)OC(C)(C)C)cc(Cl)c1NS(C)(=O)=O", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.", "role": "user" }, { "content": "Here are possible reactants: CC(C)(C)OC(=O)NC(COC(F)F)C(=O)O.NCc1ccc(F)cc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "CC(C)OC(=O)c1cccc(C#C[Si](C)(C)C)c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "CC(C)(C)OC(=O)NCc1ccc([N+](=O)[O-])cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?", "role": "user" }, { "content": "FC(F)(Cl)C=CCCCCCCCCCBr.Oc1ccc(Cl)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.NCCc1ccc(N)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>", "role": "user" }, { "content": "CCCCCCCCCCOc1cc(OCCCCCCCCCC)cc(C(=O)C(=O)N(CC(=O)OCC)CC(=O)OCC)c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Do retrosynthesis with the product <molecule_2d> .", "role": "user" }, { "content": "OK. The reactants may be CCOC(=O)CCCCCC(=O)Nc1ccccc1NC(=O)OC(C)(C)C .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: CCOC(=O)C(C)=CC(C(C)C)N(C)C(=O)C(N)C(C)(C)C.CC(C(=O)O)C(C)(C)c1ccccc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "CC(C)I.COc1ccc(Br)cc1O", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>", "role": "user" }, { "content": "CNOC.O=C(O)C(F)(F)Oc1ccc(F)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "CCOC(=O)CBr.OCc1ccc(O)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>", "role": "user" }, { "content": "NCCc1ccc(Cl)cc1.O=C(OC(=O)C(F)(F)F)C(F)(F)F", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?", "role": "user" }, { "content": "CCN.O=[N+]([O-])c1cc(Cl)ccc1Cl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "BrCCBr.Oc1cc(Cl)cc(Cl)c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): CC(S)CN.O=C(Cl)OCc1ccc([N+](=O)[O-])cc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "FCCBr.Oc1ccc(Cl)cc1Br", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "What reactants could lead to the production of the following product? <molecule_2d>", "role": "user" }, { "content": "COC(=O)C(C)c1ccc(OC)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "CCOc1cccc(C)c1.CN(C)C=O", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?", "role": "user" }, { "content": "COC(=O)c1cccc(CC(C)(C)C#N)c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): CNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.", "role": "user" }, { "content": "CCO.O=C(O)CCc1ccc(O)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "COCCO.Cc1cc(Cl)c(Cl)cc1[N+](=O)[O-]", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Do retrosynthesis with the product <molecule_2d> .", "role": "user" }, { "content": "OK. The reactants may be CCCCCCCCCc1ccc(Cl)c(Cl)c1.O=[N+]([O-])O .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "CO.Cc1cccc(CBr)c1Br", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)O.COC(=O)CCCCN", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "Cc1cc([N+](=O)[O-])ccc1N(C)C", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "CCCc1ccc(O)cc1.OCCCCCCBr", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>", "role": "user" }, { "content": "CC(C=O)Oc1ccc(OCc2ccccc2)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: CC(C)(C)OC(=O)NCCO.Cc1cc(C)c(S(=O)(=O)Cl)c(C)c1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.", "role": "user" }, { "content": "Here are possible reactants: CCCCCCCCI.OCc1ccc(CO)cc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?", "role": "user" }, { "content": "COc1ccc(CC(=O)O)cc1Br", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "COC(=O)C(NCCNC(=O)OC(C)(C)C)c1cccc(OC)c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "COc1ccc(C=O)c(F)c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?", "role": "user" }, { "content": "COCCCCNc1c(F)cccc1[N+](=O)[O-]", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>", "role": "user" }, { "content": "CC(=O)Nc1cc(Cl)ccc1C.O=C(Cl)CCl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.", "role": "user" }, { "content": "Nc1c(F)cc(F)cc1F.O=C(O)CCCCCCCCBr", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): BrBr.O=[N+]([O-])c1ccc(F)c([N+](=O)[O-])c1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.", "role": "user" }, { "content": "Here are possible reactants: CN(C)C=O.COc1ccc(Cl)cc1F .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?", "role": "user" }, { "content": "O=C(O)CCCCCCCCC=CCc1ccccc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "CCOC(=O)C(C)c1ccc(N)c(F)c1.O=S(=O)(Cl)CCCCl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?", "role": "user" }, { "content": "Cc1c(C#N)ccc([N+](=O)[O-])c1C", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "CO.O=C(Cl)c1ccc(S(=O)(=O)Cl)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>", "role": "user" }, { "content": "CCOc1cccc(C=O)c1O.O=C1CCC(=O)N1Br", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "N#Cc1ccc(C=O)cc1.NO", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>", "role": "user" }, { "content": "CCOP(=O)(OCC)C(CCc1ccccc1)NC(CC(C)C)C(=O)OCc1ccccc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>", "role": "user" }, { "content": "CN(C(=O)OC(C)(C)C)c1cc(Cl)ccc1[N+](=O)[O-]", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?", "role": "user" }, { "content": "O=C(CO)c1ccccc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: Cc1ccc(OCCCCCSC(F)(F)F)cc1SCC(F)(F)F.O=C(OO)c1cccc(Cl)c1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.", "role": "user" }, { "content": "CC(C)(C)OC(=O)NCCN.O=C(O)CCCCCNC(=O)CCNC(=O)OCc1ccccc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>", "role": "user" }, { "content": "COC(=O)c1cc(Br)cc([N+](=O)[O-])c1C", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Do retrosynthesis with the product <molecule_2d> .", "role": "user" }, { "content": "OK. The reactants may be CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CS(=O)(=O)c1ccc(N)cc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: CC(C)(C)[Si](C)(C)OCc1cccc(C#C[Si](C)(C)C)c1F .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>", "role": "user" }, { "content": "CC(=O)OC(C)=O.Nc1cc(Cl)ccc1O", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>", "role": "user" }, { "content": "Nc1c(Br)cc(F)cc1[N+](=O)[O-]", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Do retrosynthesis with the product <molecule_2d> .", "role": "user" }, { "content": "OK. The reactants may be CC(C)(C)OC(=O)NC(Cc1ccc(C#N)cc1)C(=O)O.CC(C)NC(C)C .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "What reactants could lead to the production of the following product? <molecule_2d>", "role": "user" }, { "content": "BrBr.Nc1c([N+](=O)[O-])cccc1C(F)(F)F", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): Cc1ccc(O)cc1F.O=[N+]([O-])O .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?", "role": "user" }, { "content": "CC(=O)Cc1ccc(O)cc1.CC(C)(C)[Si](C)(C)Cl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>", "role": "user" }, { "content": "CON.O=C(CF)Cc1ccc(Cl)cc1Cl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?", "role": "user" }, { "content": "CON.O=Cc1ccc(F)cc1Cl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>", "role": "user" }, { "content": "COc1cc([N+](=O)[O-])ccc1C#N", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>", "role": "user" }, { "content": "OCc1ccc(Cl)c(Br)c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>", "role": "user" }, { "content": "CC(C)CCN.O=C(Cl)Oc1ccccc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "What reactants could lead to the production of the following product? <molecule_2d>", "role": "user" }, { "content": "O=C(O)c1cc(F)c(F)cc1[N+](=O)[O-]", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>", "role": "user" }, { "content": "CCCCCCCCCCCCBr.Oc1ccc(Br)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>", "role": "user" }, { "content": "O=C(O)c1ccc(I)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>", "role": "user" }, { "content": "O=C(O)c1cc([N+](=O)[O-])ccc1Cl.O=S(Cl)Cl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>", "role": "user" }, { "content": "CC(=O)NCCc1cccc([N+](=O)[O-])c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): CCOC(=O)COc1ccc(F)cc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: COCOc1ccc(Br)cc1C=O .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.", "role": "user" }, { "content": "COC(=O)c1cc(Br)cc([N+](=O)[O-])c1C", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?", "role": "user" }, { "content": "CCOCCN.O=S(=O)(Cl)c1ccc(I)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "CC(N)C(=O)NCC(=O)OCc1ccccc1.CC(NC(=O)CNC(=O)OC(C)(C)C)C(=O)NCC(=O)O", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): CCCCCCCCCCCCS(=O)(=O)c1ccc(C(=O)O)cc1.O=S(Cl)Cl .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "CC(C)(C)OC(=O)NC(Cc1ccc([N+](=O)[O-])cc1)C(=O)O.CI", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "What reactants could lead to the production of the following product? <molecule_2d>", "role": "user" }, { "content": "CC(=O)OC(C)=O.Nc1cc(Br)ccc1OC(F)(F)F", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: COCCl.OCc1ccccc1I .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "What reactants could lead to the production of the following product? <molecule_2d>", "role": "user" }, { "content": "CC(=O)OC(C)=O.OCCc1c(F)cc(Br)cc1F", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.NCC(O)c1ccccc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>", "role": "user" }, { "content": "CC(C)C(O)C(C)NC(=O)OC(C)(C)C.O=C(O)c1ccc([N+](=O)[O-])cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): CCOC(=O)CCCCCN=C=O.Cc1cc(N)cc([N+](=O)[O-])c1Br .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?", "role": "user" }, { "content": "CO.O=C(O)c1cc(Br)ccc1Cl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: O=C(O)CCc1ccc(CO)cc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.", "role": "user" }, { "content": "Here are possible reactants: C=CCOCCc1ccc(OCC2CO2)cc1.CC(C)N .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): COC(=O)C=Cc1ccc(C)c(OC)c1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?", "role": "user" }, { "content": "CS(=O)(=O)Cl.N#Cc1ccc(COCCO)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "What reactants could lead to the production of the following product? <molecule_2d>", "role": "user" }, { "content": "COc1cccc(CCCO)c1.O=C1CCC(=O)N1Br", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "C=CCc1c(O)ccc(C(N)=O)c1O", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?", "role": "user" }, { "content": "CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC(C)(CN)SCc1ccccc1", "role": "assistant" } ]