Datasets:

---

OpenMol

/

MolInst_RS_125K_SMILES_1_32_MMChat

like 0

Follow

OpenMol 6

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?", "role": "user" }, { "content": "CC(C)(C)[Si](C)(C)Cl.Cc1cccc(O)c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): C=CCBr.O=[N+]([O-])c1ccc(O)cc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?", "role": "user" }, { "content": "CC(C)OB(OC(C)C)OC(C)C.Cc1cc(C(C)(C)C)ccc1Br", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>", "role": "user" }, { "content": "CNC.Nc1ccc(C(=O)O)cc1Cl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.", "role": "user" }, { "content": "O=C(O)Cc1ccc([N+](=O)[O-])cc1.O=S(Cl)Cl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.NC(CCCO)c1ccc(Cl)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "COCCl.Cc1cc(C)c(Br)c(O)c1C", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "O=Cc1cc(O)ccc1[N+](=O)[O-].OCCCBr", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "NCCO.O=Cc1cccc(Br)c1O", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "COc1cc(OC)c([N+](=O)[O-])cc1C(=O)CCCCCl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Do retrosynthesis with the product <molecule_2d> .", "role": "user" }, { "content": "OK. The reactants may be C=CC(=O)NCCCCCC(=O)NC(Cc1ccccc1)C(=O)OCC .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): Cc1cccc(S(=O)(=O)NC(C)C)c1[N+](=O)[O-] .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: C#CCCCCCCCC.O=Cc1ccc(Br)cc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?", "role": "user" }, { "content": "COC(=O)CCc1ccc(O)cc1.OCCSCCO", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>", "role": "user" }, { "content": "Cc1cc(Cl)c(C)c([N+](=O)[O-])c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "CC(C)(C)OC(=O)NS(=O)(=O)NCc1ccc([N+](=O)[O-])cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "CC(C)[Si](Cl)(C(C)C)C(C)C.OCc1cc(Br)ccc1Cl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>", "role": "user" }, { "content": "Cc1cc(C#N)ccc1[N+](=O)[O-]", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.", "role": "user" }, { "content": "COC(=O)c1ccc(O[Si](C)(C)C(C)(C)C)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "OCCCOCCCCc1ccccc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): CCOP(=O)(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)OCC .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.", "role": "user" }, { "content": "Here are possible reactants: N#Cc1c(F)cccc1I .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?", "role": "user" }, { "content": "CC(C)(C)N.O=S(=O)(Cl)c1cccc(S(=O)(=O)Cl)c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "COC(=O)CCN.O=C(O)c1cc(Cl)c([N+](=O)[O-])cc1[N+](=O)[O-]", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "CC(C)NC(=O)c1cc(F)ccc1F", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Do retrosynthesis with the product <molecule_2d> .", "role": "user" }, { "content": "OK. The reactants may be CC(=O)c1cc([N+](=O)[O-])c(O)c(C(C)(C)C)c1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?", "role": "user" }, { "content": "CCCOc1c(C=O)cccc1C(C)(C)C.CN", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: COc1ccc(C(=O)CCC(=O)O)cc1[N+](=O)[O-] .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Do retrosynthesis with the product <molecule_2d> .", "role": "user" }, { "content": "OK. The reactants may be BrBr.Nc1ccc([N+](=O)[O-])cc1F .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.", "role": "user" }, { "content": "Here are possible reactants: COC(=O)c1ccc(S(C)(=O)=O)c(C(=O)NC(C)(C)CO)c1Cl.O=S(Cl)Cl .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.", "role": "user" }, { "content": "Here are possible reactants: OCc1cc(I)ccc1Cl .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: Cc1c(CC#N)cccc1[N+](=O)[O-] .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "What reactants could lead to the production of the following product? <molecule_2d>", "role": "user" }, { "content": "COC(=O)Cl.NCCc1ccccc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.", "role": "user" }, { "content": "CNCCO.O=Cc1ccc(S(=O)(=O)Cl)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "COC(=O)C=CC=C(C)c1ccc(OC)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?", "role": "user" }, { "content": "CC(C)(C)[Si](C)(C)Cl.OCc1cc(Br)ccc1Cl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: CCC(C)C(CO)N(C)C(=O)OCc1ccccc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>", "role": "user" }, { "content": "CCCCCCCNC(=O)Cc1ccc(CO)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): CO.COc1cc([N+](=O)[O-])ccc1CC(=O)O .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.", "role": "user" }, { "content": "O=C1CCC(=O)N1Br.OCCCc1cccc(Br)c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): CCOC(=O)COc1cc(OC)c(Cl)cc1C(O)C(C)C .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: O=C(O)CC(O)C(=O)O.OCc1ccccc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "C#CC(C)(C)O.CCCCc1ccc(Br)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "CI.Cc1c(C(=O)O)cc(Cl)cc1[N+](=O)[O-]", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.", "role": "user" }, { "content": "COC(=O)Cc1ccc(O)c(C)c1.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: CC(C)Nc1cc(Br)ccc1C(=O)O.CI .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.", "role": "user" }, { "content": "Here are possible reactants: CC#CCOc1ccc(CC(NC(=O)OC(C)(C)C)C(=O)O)cc1.CNC .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.", "role": "user" }, { "content": "Here are possible reactants: CCC(C)S(N)(=O)=O.O=C(O)c1cc(F)c(F)cc1F .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "Cc1cc(F)ccc1[N+](=O)[O-].NC(CO)CO", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>", "role": "user" }, { "content": "CC(C)I.Cc1c(Br)cc(O)cc1Br", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>", "role": "user" }, { "content": "CN(C)CCCN.Cc1ccc(Cl)c([N+](=O)[O-])c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "COC(=O)c1ccc(CC(C)C)c(C#N)c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>", "role": "user" }, { "content": "N.Nc1c(Cl)cccc1C(=O)O", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>", "role": "user" }, { "content": "CC(=O)OC(C)=O.N#Cc1cc(Cl)ccc1O", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.", "role": "user" }, { "content": "COC(=O)c1ccc(C(C)(C)C)cc1Cl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "COc1cccc(C=O)c1[N+](=O)[O-]", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>", "role": "user" }, { "content": "CO.O=C(O)C(O)c1ccccc1Cl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.", "role": "user" }, { "content": "CN.O=Cc1ccccc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "CCCN(CCCCC(=O)O)c1ccc(Br)cc1C=O.CI", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: CC(=O)c1ccc(O)cc1C.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.", "role": "user" }, { "content": "CI.O=[N+]([O-])c1cc(Br)cc(CO)c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "CC(C)(C)C#Cc1cc([N+](=O)[O-])c(F)cc1N.CCCC(=O)Cl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "CCCCCC=CCC=CCCO.Cc1ccc(S(=O)(=O)Cl)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "CC(C)CC(C(=O)NN(CC(C)C)C(=O)C(C)O)C(CC=Cc1ccccc1)C(=O)NOC1CCCCO1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>", "role": "user" }, { "content": "II.Nc1ccc([N+](=O)[O-])cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Do retrosynthesis with the product <molecule_2d> .", "role": "user" }, { "content": "OK. The reactants may be CCO.O=C(O)c1ccc(F)c(Br)c1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.", "role": "user" }, { "content": "COC(=O)c1cc(O)c(O)c(O)c1.FCCBr", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?", "role": "user" }, { "content": "CCOC(=O)CCCBr.Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.", "role": "user" }, { "content": "C#CCCCOS(=O)(=O)c1ccc(C)cc1.COc1cc(C=O)ccc1O", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): CN.N#Cc1c(Cl)ccc([N+](=O)[O-])c1Cl .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>", "role": "user" }, { "content": "CO.O=C(O)c1cccc([N+](=O)[O-])c1Cl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?", "role": "user" }, { "content": "CCOC(=O)CBr.Oc1ccccc1I", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Do retrosynthesis with the product <molecule_2d> .", "role": "user" }, { "content": "OK. The reactants may be CS(=O)(=O)Nc1ccc([N+](=O)[O-])cc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: CCCC(=O)c1ccc(Br)cc1O.CI .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): CC(=O)c1cc(Br)cc([N+](=O)[O-])c1O.COS(=O)(=O)OC .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>", "role": "user" }, { "content": "COC(=O)c1ccc(NCC(F)(F)F)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.", "role": "user" }, { "content": "Here are possible reactants: CCOC(=O)COc1ccc(OC(C)=O)cc1C .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>", "role": "user" }, { "content": "CC[S-].Fc1ccc(Br)cc1Cl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?", "role": "user" }, { "content": "COC(=O)COc1ccc(C#C[Si](C)(C)C)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.", "role": "user" }, { "content": "Here are possible reactants: Cc1cc(Br)cc(C)c1O.Cc1ccc(S(=O)(=O)OCCC(C)(C)O)cc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "What reactants could lead to the production of the following product? <molecule_2d>", "role": "user" }, { "content": "CCCc1ccc(CCC(=O)OCC)cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Do retrosynthesis with the product <molecule_2d> .", "role": "user" }, { "content": "OK. The reactants may be CC(=O)Cl.COc1ccc(OC)cc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "CCCCCCCCCC#Cc1ccccc1F.CN(C)C=O", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Do retrosynthesis with the product <molecule_2d> .", "role": "user" }, { "content": "OK. The reactants may be CC(C)(C)OC(=O)Nc1ccc(CCC(=O)O)cc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "What reactants could lead to the production of the following product? <molecule_2d>", "role": "user" }, { "content": "OCCCBr.Oc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>", "role": "user" }, { "content": "CC(C)N.O=C(O)c1ccc(Br)c(F)c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Do retrosynthesis with the product <molecule_2d> .", "role": "user" }, { "content": "OK. The reactants may be N#CCCC(C(=O)O)c1ccccc1C(F)(F)F .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Given the following product, please provide possible reactants. <molecule_2d>", "role": "user" }, { "content": "Possible reactant(s): CCCNCCC.O=C(O)Cc1ccc(O)c([N+](=O)[O-])c1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: CC(C)(C)OC(=O)NC(CCCNC(N)=N[N+](=O)[O-])C(=O)O.NCc1ccc(CNC(N)=O)cc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "Cc1cc(F)cc([N+](=O)[O-])c1C#N", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .", "role": "user" }, { "content": "The potential reactants: N#Cc1ccc(O)cc1.OCCCCCCCCCl .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>", "role": "user" }, { "content": "CCCCCCCCBr.O=Cc1ccc(O)cc1O", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.", "role": "user" }, { "content": "BrBr.CC(=O)c1ccc(C)c(S(N)(=O)=O)c1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.", "role": "user" }, { "content": "BrBr.CC(C)c1ccc([N+](=O)[O-])cc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.", "role": "user" }, { "content": "CCCS(=O)(=O)Nc1cc([N+](=O)[O-])ccc1C", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>", "role": "user" }, { "content": "CCOC(=O)CCC(C)=O.O=Cc1ccccc1", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "What reactants could lead to the production of the following product? <molecule_2d>", "role": "user" }, { "content": "C=CCC(C)Oc1cc(C)ccc1CO", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Do retrosynthesis with the product <molecule_2d> .", "role": "user" }, { "content": "OK. The reactants may be COC(=O)CCCCCCCCCOc1ccc(C(=O)OC(C)(C)C)cc1 .", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?", "role": "user" }, { "content": "Cc1cc(C=O)ccc1Br.NO", "role": "assistant" } ]

[ { "content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.", "role": "system" }, { "content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?", "role": "user" }, { "content": "CCCc1ccc(C(=O)O)cc1.O=[N+]([O-])O", "role": "assistant" } ]